| Name |
Luvangetin |
| Formula |
C15H14O4 |
| Mw |
258.08920894 |
| CAS RN |
483-92-1 |
| C_ID |
C00002481
, 
|
| InChIKey |
XYPWCJWXFYYGPA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H14O4/c1-15(2)7-6-10-8-9-4-5-11(16)18-12(9)14(17-3)13(10)19-15/h4-8H,1-3H3 |
| SMILES |
COc1c2c(cc3ccc(=O)oc13)C=CC(C)(C)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Moraceae | Brosimum rubescens  | Ref. |
| Plantae | Rutaceae | Aegle marmelos  | Ref. |
| Plantae | Rutaceae | Boenninghausenia albiflora  | Ref. |
| Plantae | Rutaceae | Chloroxylon swietenia  | Ref. |
| Plantae | Rutaceae | Hesperethusa crenulata | Ref. |
| Plantae | Rutaceae | Luvunga scandens  | Ref. |
| Plantae | Rutaceae | Phebalium clavatum | Ref. |
|
|
zoom in
| Organism | Aegle marmelos | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|