| Name |
Acetylursolic acid Ursolic acid Ursolic acid acetate |
| Formula |
C32H50O4 |
| Mw |
498.37091008 |
| CAS RN |
7372-30-7 |
| C_ID |
C00029633
, 
|
| InChIKey |
PHFUCJXOLZAQNH-GTFLZTGMNA-N |
| InChICode |
InChI=1S/C32H50O4/c1-19-11-16-32(27(34)35)18-17-30(7)22(26(32)20(19)2)9-10-24-29(6)14-13-25(36-21(3)33)28(4,5)23(29)12-15-31(24,30)8/h9,19-20,23-26H,10-18H2,1-8H3,(H,34,35)/t19-,20+,23+,24-,25+,26+,29+,30-,31-,32+/m1/s1 |
| SMILES |
CC(=O)O[C@H]1CC[C@]2(C)[C@H]3CC=C4[C@@H]5[C@@H](C)[C@H](C)CC[C@]5(C(=O)O)CC[C@@]4(C)[C@]3(C)CC[C@H]2C1(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Adoxaceae | Viburnum lantana L.  | Ref. |
| Plantae | Amaranthaceae | Achyranthes aspera  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Heracleum granatense | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Apocynaceae | Nerium oleander  | Ref. |
| Plantae | Apocynaceae | Plumeria obtusa  | Ref. |
| Plantae | Aquifoliaceae | Ilex asprella | Ref. |
| Plantae | Aquifoliaceae | Ilex cornuta  | Ref. |
| Plantae | Aquifoliaceae | Ilex integra | Ref. |
| Plantae | Aquifoliaceae | Ilex pubescens  | Ref. |
| Plantae | Araliaceae | Acanthopanax senticosus  | Ref. |
| Plantae | Araliaceae | Acanthopanax sessiliflorus | Ref. |
| Plantae | Araliaceae | Centella asiatica  | Ref. |
| Plantae | Araliaceae | Cussonia bancoensis | Ref. |
| Plantae | Asteraceae | Achyrocline bogotensis (HBK.) DC. | Ref. |
| Plantae | Asteraceae | Ligularia sagitta | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum polyanthum | Ref. |
| Plantae | Cecropiaceae | Myrianthus arboreus  | Ref. |
| Plantae | Celastraceae | Microtropis japonica | Ref. |
| Plantae | Combretaceae | Terminalia fagifolia | Ref. |
| Plantae | Convallariaceae | Liriope muscari  | Ref. |
| Plantae | Cornaceae | Camptotheca acuminata | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus kousa | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Cruciferae | Isatis tinctoria  | Ref. |
| Plantae | Cynomoriaceae | Cynomorium songaricum | Ref. |
| Plantae | Dipterocarpaceae | Vatica cinerea | Ref. |
| Plantae | Ebenaceae | Diospyros castanea | Ref. |
| Plantae | Ebenaceae | Diospyros cauliflora | Ref. |
| Plantae | Ebenaceae | Diospyros curranii | Ref. |
| Plantae | Ebenaceae | Diospyros ebenum  | Ref. |
| Plantae | Ebenaceae | Diospyros evena | Ref. |
| Plantae | Ebenaceae | Diospyros ferrea | Ref. |
| Plantae | Ebenaceae | Diospyros hirsuta | Ref. |
| Plantae | Ebenaceae | Diospyros kaki  | Ref. |
| Plantae | Ebenaceae | Diospyros leucomelas | Ref. |
| Plantae | Ebenaceae | Diospyros lotus  | Ref. |
| Plantae | Ebenaceae | Diospyros malanonilau | Ref. |
| Plantae | Ebenaceae | Diospyros melanoxylon  | Ref. |
| Plantae | Ebenaceae | Diospyros montana  | Ref. |
| Plantae | Ebenaceae | Diospyros morrisiana | Ref. |
| Plantae | Ebenaceae | Diospyros quaesita | Ref. |
| Plantae | Ebenaceae | Diospyros tomentosa  | Ref. |
| Plantae | Ericaceae | Arbutus andrachne L.  | Ref. |
| Plantae | Ericaceae | Enkianthus cernuus | Ref. |
| Plantae | Ericaceae | Epigaea asiatica | Ref. |
| Plantae | Ericaceae | Leucothoe grayana Max. | Ref. |
| Plantae | Ericaceae | Pieris japonica D.Don.  | Ref. |
| Plantae | Ericaceae | Pyrola incarnata | Ref. |
| Plantae | Ericaceae | Pyrola japonica  | Ref. |
| Plantae | Ericaceae | Pyrola rugosa | Ref. |
| Plantae | Ericaceae | Rhododendron hymenanthus | Ref. |
| Plantae | Eucommiaceae | Eucommia ulmoides  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia paralias | Ref. |
| Plantae | Fabaceae | Indigofera tetrantha | Ref. |
| Plantae | Gentianaceae | Gentianopsis paludosa | Ref. |
| Plantae | Hydrangeaceae | Hydrangea heteromalla | Ref. |
| Plantae | Icacinaceae | Gonocaryum calleryanum  | Ref. |
| Plantae | Juglandaceae | Platycarya strobilacea | Ref. |
| Plantae | Labiatae | Callicarpa arborea  | Ref. |
| Plantae | Labiatae | Callicarpa formosana  | Ref. |
| Plantae | Labiatae | Callicarpa macrophylla  | Ref. |
| Plantae | Labiatae | Dracocephalum kotschyi  | Ref. |
| Plantae | Labiatae | Glechoma lungituba | Ref. |
| Plantae | Labiatae | Hyptis brevipes  | Ref. |
| Plantae | Labiatae | Isodon oresbia | Ref. |
| Plantae | Labiatae | Isodon ternifolius | Ref. |
| Plantae | Labiatae | Lavandula canariensis | Ref. |
| Plantae | Labiatae | Lavandula gibsonii | Ref. |
| Plantae | Labiatae | Meriandra benghalensis  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Origanum dubium | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Labiatae | Orthosiphon stamineus  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Labiatae | Prostanthera melissifolia | Ref. |
| Plantae | Labiatae | Prunella vulgaris  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Salvia breviflora | Ref. |
| Plantae | Labiatae | Salvia canariensis L. | Ref. |
| Plantae | Labiatae | Salvia chinopeplica | Ref. |
| Plantae | Labiatae | Salvia miltiorrhiza  | Ref. |
| Plantae | Labiatae | Salvia nicolsoniana | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Salvia virgata | Ref. |
| Plantae | Labiatae | Satureja acinos | Ref. |
| Plantae | Labiatae | Satureja calamintha | Ref. |
| Plantae | Labiatae | Sideritis candicans var.eriocephala | Ref. |
| Plantae | Labiatae | Sideritis discolor | Ref. |
| Plantae | Labiatae | Sideritis soluta | Ref. |
| Plantae | Labiatae | Thymus pubescens | Ref. |
| Plantae | Lamiaceae | Coleus aromaticus  | Ref. |
| Plantae | Lamiaceae | Rabdosia rubescens  | Ref. |
| Plantae | Longaniaceae | Strychnos vanprukii Craib. | Ref. |
| Plantae | Lythraceae | Lawsonia inermis  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malpighiaceae | Acridocarpus vivy | Ref. |
| Plantae | Melastomataceae | Monochaetum vulcanicum | Ref. |
| Plantae | Moraceae | Ficus microcarpa  | Ref. |
| Plantae | Moraceae | Morus australis  | Ref. |
| Plantae | Myricaceae | Myrica rubra  | Ref. |
| Plantae | Myrtaceae | Eucalyptus citriodora  | Ref. |
| Plantae | Myrtaceae | Eucalyptus tereticornis  | Ref. |
| Plantae | Myrtaceae | Leptospermum scoparium  | Ref. |
| Plantae | Myrtaceae | Melaleuca ericifolia | Ref. |
| Plantae | Myrtaceae | Melaleuca leucadendron  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Myrtaceae | Syzygium buxifolium | Ref. |
| Plantae | Myrtaceae | Syzygium formosanum | Ref. |
| Plantae | Oleaceae | Forsythia suspensa  | Ref. |
| Plantae | Oleaceae | Ligustrum lucidum  | Ref. |
| Plantae | Oleaceae | Phillyrea latifolia L.  | Ref. |
| Plantae | Onagraceae | Ludwigia octovalvis  | Ref. |
| Plantae | Paulowniaceae | Paulownia tomentosa | Ref. |
| Plantae | Pinaceae | Pinus roxburghii  | Ref. |
| Plantae | Plantaginaceae | Plantago asiatica  | Ref. |
| Plantae | Plantaginaceae | Plantago depressa  | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Polygonaceae | Coccoloba excoriata | Ref. |
| Plantae | Rhamnaceae | Ziziphus jujuba  | Ref. |
| Plantae | Rhamnaceae | Ziziphus jujuba var.spinosa  | Ref. |
| Plantae | Rosaceae | Chaenomeles sinensis  | Ref. |
| Plantae | Rosaceae | Crataegus cuneata  | Ref. |
| Plantae | Rosaceae | Crataegus hupehensis | Ref. |
| Plantae | Rosaceae | Crataegus pinnatifida  | Ref. |
| Plantae | Rosaceae | Crataegus pinnatifida var.major  | Ref. |
| Plantae | Rosaceae | Eriobotrya japonica  | Ref. |
| Plantae | Rosaceae | Photinia serrulata | Ref. |
| Plantae | Rosaceae | Potentilla chinensis  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Prunus serotina  | Ref. |
| Plantae | Rosaceae | Rosa multiflora  | Ref. |
| Plantae | Rosaceae | Rubus ellipticus  | Ref. |
| Plantae | Rubiaceae | Coussarea paniculata | Ref. |
| Plantae | Rubiaceae | Gardenia jasminoides  | Ref. |
| Plantae | Rubiaceae | Hedyotis dichotoma | Ref. |
| Plantae | Rubiaceae | Hedyotis herbacea | Ref. |
| Plantae | Rubiaceae | Lasianthus gardneri | Ref. |
| Plantae | Rubiaceae | Mitragyna speciosa | Ref. |
| Plantae | Rubiaceae | Mitragyna stipulosa  | Ref. |
| Plantae | Rubiaceae | Morinda citrifolia  | Ref. |
| Plantae | Rubiaceae | Morinda officinalis  | Ref. |
| Plantae | Rubiaceae | Morinda tinctoria var.tomentosa.  | Ref. |
| Plantae | Rubiaceae | Oldenlandia diffusa  | Ref. |
| Plantae | Rubiaceae | Ophiorrhiza liukiuensis | Ref. |
| Plantae | Rubiaceae | Rubia wallichiana  | Ref. |
| Plantae | Rubiaceae | Uncaria tomentosa  | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana laxiflora | Ref. |
| Plantae | Verbenaceae | Verbena littoralis  | Ref. |
| Plantae | Verbenaceae | Verbena officinalis  | Ref. |
| - | - | Aganosma caryophyllata | Ref. |
| - | - | Clerodendranthus spicatus | Ref. |
| - | - | Hex aquifolium | Ref. |
|
|
zoom in
| Organism | Lawsonia inermis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|