| Name |
(-)-Kikemanine Kikemanin Kikemanine Schefferine (-)-Corydalmine Corydalmine |
| Formula |
C20H23NO4 |
| Mw |
341.16270823 |
| CAS RN |
30413-84-4 |
| C_ID |
C00025241
, 
|
| InChIKey |
DIHXHTWYVOYYDC-XISACWJONA-N |
| InChICode |
InChI=1S/C20H23NO4/c1-23-18-9-13-6-7-21-11-15-12(4-5-17(22)20(15)25-3)8-16(21)14(13)10-19(18)24-2/h4-5,9-10,16,22H,6-8,11H2,1-3H3/t16-/m0/s1 |
| SMILES |
COc1cc2c(cc1OC)[C@@H]1Cc3ccc(O)c(OC)c3CN1CC2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Tyr |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Annona cherimola  | Ref. |
| Plantae | Annonaceae | Annona glabra  | Ref. |
| Plantae | Annonaceae | Fissistigma balansae | Ref. |
| Plantae | Annonaceae | Polyalthia oligosperma Danguy Diels | Ref. |
| Plantae | Annonaceae | Schefferomitra subaequalis | Ref. |
| Plantae | Annonaceae | Xylopia vieillardi | Ref. |
| Plantae | Fumariaceae | Corydalis chaerophylla  | Ref. |
| Plantae | Fumariaceae | Corydalis pallida Pers.var.tenuis Yatabe. | Ref. |
| Plantae | Fumariaceae | Corydalis solida  | Ref. |
| Plantae | Fumariaceae | Corydalis yanhusuo  | Ref. |
| Plantae | Menispermaceae | Stephania glabra Miers  | Ref. |
| Plantae | Menispermaceae | Stephania glabra (Roxb.) Miers  | Ref. |
| Plantae | Menispermaceae | Stephania hainanensis H.S.Lo & Y. | Ref. |
| Plantae | Menispermaceae | Stephania intermedia H.S.Lo. | Ref. |
| Plantae | Menispermaceae | Stephania macrantha | Ref. |
| Plantae | Menispermaceae | Stephania micrantha H.S.Lo | Ref. |
| Plantae | Menispermaceae | Stephania officinarum | Ref. |
| Plantae | Menispermaceae | Stephania pierrei Diels (=S.erecta Craib)  | Ref. |
| Plantae | Menispermaceae | Stephania suberosa Forman | Ref. |
| Plantae | Menispermaceae | Stephania succinifera H.S.Lo | Ref. |
| Plantae | Menispermaceae | Stephania venosa Spreng | Ref. |
| Plantae | Menispermaceae | Stephania yunnanensis H.S Lo | Ref. |
| Plantae | Ranunculaceae | Thalictrum minus | Ref. |
| Plantae | Rutaceae | Zanthoxylum taediosum | Ref. |
|
|
zoom in
| Organism | Corydalis yanhusuo | | Reference | Likhitwitayawuid, et al., Journal of Natural Products, 56, (1993), 1468.
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979). |
|---|
|