| Name |
Butein |
| Formula |
C15H12O5 |
| Mw |
272.06847349 |
| CAS RN |
487-52-5 |
| C_ID |
C00006941
, 
|
| InChIKey |
AYMYWHCQALZEGT-ORCRQEGFSA-N |
| InChICode |
InChI=1S/C15H12O5/c16-10-3-4-11(14(19)8-10)12(17)5-1-9-2-6-13(18)15(20)7-9/h1-8,16,18-20H/b5-1+ |
| SMILES |
O=C(/C=C/c1ccc(O)c(O)c1)c1ccc(O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Rhus javanica  | Ref. |
| Plantae | Anacardiaceae | Toxicodendron semilata | Ref. |
| Plantae | Anacardiaceae | Toxicodendron vernicifluum | Ref. |
| Plantae | Asteraceae | Baeria chrysostoma | Ref. |
| Plantae | Asteraceae | Bidens spp. | Ref. |
| Plantae | Asteraceae | Coreopsis maritima | Ref. |
| Plantae | Asteraceae | Dahlia variabilis  | Ref. |
| Plantae | Asteraceae | Viguiera eriophora | Ref. |
| Plantae | Asteraceae | Viguiera multiflora | Ref. |
| Plantae | Fabaceae | Acacia spp.  | Ref. |
| Plantae | Fabaceae | Butea frondosa  | Ref. |
| Plantae | Fabaceae | Caesalpinia japonica | Ref. |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Fabaceae | Robinia pseudoacacia  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
|
|
zoom in
| Organism | Acacia spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Drewes,Biochem.J.,87,(1963),167
Imamura,Nippon Mokuzai Gakkai,13,(1967),296 |
|---|
|