| Name |
Cristacarpin Erythrabyssin I |
| Formula |
C21H22O5 |
| Mw |
354.14672381 |
| CAS RN |
74515-47-2 |
| C_ID |
C00002515
, 
|
| InChIKey |
ZHPYEBFYLDGZKF-VJOGAFQXNA-N |
| InChICode |
InChI=1S/C21H22O5/c1-12(2)4-6-14-17(24-3)9-8-16-19(14)26-20-15-7-5-13(22)10-18(15)25-11-21(16,20)23/h4-5,7-10,20,22-23H,6,11H2,1-3H3/t20-,21+/m0/s1 |
| SMILES |
COc1ccc2c(c1CC=C(C)C)O[C@H]1c3ccc(O)cc3OC[C@@]21O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Erythrina abyssinica  | Ref. |
| Plantae | Fabaceae | Erythrina crista-galli  | Ref. |
| Plantae | Fabaceae | Erythrina fusca  | Ref. |
| Plantae | Fabaceae | Erythrina latissima | Ref. |
| Plantae | Fabaceae | Erythrina lysistemon  | Ref. |
| Plantae | Fabaceae | Erythrina poeppigiana  | Ref. |
| Plantae | Fabaceae | Erythrina sandwicensis | Ref. |
| Plantae | Fabaceae | Erythrina suberosa var. glabrescences  | Ref. |
| Plantae | Fabaceae | Erythrina variegata  | Ref. |
| Plantae | Fabaceae | Psophocarpus tetragonolobus  | Ref. |
|
|
zoom in
| Organism | Psophocarpus tetragonolobus | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Ingham,Phytochem.,19,(1980),1203
Kamat,Heterocycles,15,(1981),1163 |
|---|
|