| Name |
(-)-Lariciresinol |
| Formula |
C20H24O6 |
| Mw |
360.1572885 |
| CAS RN |
83327-19-9 |
| C_ID |
C00000603
, 
|
| InChIKey |
MHXCIKYXNYCMHY-KICIYKGHNA-N |
| InChICode |
InChI=1S/C20H24O6/c1-24-18-8-12(3-5-16(18)22)7-14-11-26-20(15(14)10-21)13-4-6-17(23)19(9-13)25-2/h3-6,8-9,14-15,20-23H,7,10-11H2,1-2H3/t14-,15-,20+/m1/s1 |
| SMILES |
COc1cc(C[C@@H]2CO[C@@H](c3ccc(O)c(OC)c3)[C@@H]2CO)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araucariaceae | Araucaria angustifolia | Ref. |
| Plantae | Asteraceae | Arctium lappa  | Ref. |
| Plantae | Balanophoraceae | Balanophora abbreviata B1 | Ref. |
| Plantae | Cupressaceae | Thuja plicata | Ref. |
| Plantae | Fabaceae | Dipteryx odorata  | Ref. |
| Plantae | Fabaceae | Prosopis juliflora (Sw.) DC.  | Ref. |
| Plantae | Linaceae | Linum usitatissimum  | Ref. |
| Plantae | Pinaceae | Larix decidua  | Ref. |
| Plantae | Thymelaeaceae | Daphne odora  | Ref. |
| Plantae | Thymelaeaceae | Daphne tangutica | Ref. |
| Plantae | Thymelaeaceae | Dirca occidentalis | Ref. |
|
|
zoom in
| Organism | Daphne tangutica | | Reference | Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Guo, et al., Natural Product Research and Development(Tianran Chanwu Yanjiu Yu Kaifa), 16, (2005), 88
Barton,Comprehensive natural products chemistry,Elsevier,vol1,(1999),1.25 |
|---|
|