| Name |
Hyperin Quercetin-3-beta-galactoside Quercetin 3-galactoside Hyperoside Quercetin 3-O-beta-D-galactopyranoside Quercetin 3-O-beta-D-galactoside Quercetin 3-O-galactoside Quercetin 3-beta-galactopyranoside |
| Formula |
C21H20O12 |
| Mw |
464.09547611 |
| CAS RN |
482-36-0 |
| C_ID |
C00005372
, 
|
| InChIKey |
OVSQVDMCBVZWGM-WPPCZBDQNA-N |
| InChICode |
InChI=1S/C21H20O12/c22-6-13-15(27)17(29)18(30)21(32-13)33-20-16(28)14-11(26)4-8(23)5-12(14)31-19(20)7-1-2-9(24)10(25)3-7/h1-5,13,15,17-18,21-27,29-30H,6H2/t13-,15+,17-,18+,21+/m1/s1 |
| SMILES |
O=c1c(O[C@@H]2O[C@H](CO)[C@H](O)C(O)C2O)c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Lycaenidae | Polyommatus icarus | Ref. |
| Chromalveolata | Lessoniaceae | Ecklonia cava  | Ref. |
| Plantae | Alliaceae | Allium obliquum  | Ref. |
| Plantae | Alliaceae | Allium sativum  | Ref. |
| Plantae | Alliaceae | Allium Sativum | Ref. |
| Plantae | Amaryllidaceae | Galanthus caucasicus  | Ref. |
| Plantae | Amaryllidaceae | Lycoris radiata  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Anacardiaceae | Rhus wallichi | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apocynaceae | Amsonia ciliata | Ref. |
| Plantae | Apocynaceae | Apocynum venetum  | Ref. |
| Plantae | Araliaceae | Kalopanax septemlobus  | Ref. |
| Plantae | Asparagaceae | Asparagus racemosus  | Ref. |
| Plantae | Asteraceae | Artemisia capillaris  | Ref. |
| Plantae | Asteraceae | Asanthus thyrsiflora | Ref. |
| Plantae | Asteraceae | Clibadium spp. | Ref. |
| Plantae | Asteraceae | Desmanthodium spp. | Ref. |
| Plantae | Asteraceae | Eupatorium lindleyanum | Ref. |
| Plantae | Asteraceae | Gutierrezia grandis | Ref. |
| Plantae | Asteraceae | Haplopappus foliosus | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Asteraceae | Senecio cymosus | Ref. |
| Plantae | Asteraceae | Senecio otiles | Ref. |
| Plantae | Asteraceae | Senecio yegua | Ref. |
| Plantae | Asteraceae | Tussilago farfara  | Ref. |
| Plantae | Berberidaceae | Epimedium brevicornum  | Ref. |
| Plantae | Berberidaceae | Epimedium koreanum  | Ref. |
| Plantae | Berberidaceae | Epimedium sagittatum  | Ref. |
| Plantae | Betulaceae | Betula middendorfii | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Campanula glomerata L. | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Celastraceae | Euonymus sacrosancta | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
| Plantae | Commelinaceae | Commelina communis  | Ref. |
| Plantae | Convallariaceae | Convallaria keiskei  | Ref. |
| Plantae | Convolvulaceae | Cuscuta chinensis  | Ref. |
| Plantae | Cornaceae | Camptotheca acuminata | Ref. |
| Plantae | Crassulaceae | Sedum sarmentosum  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cunoniaceae | Eucryphia spp. | Ref. |
| Plantae | Dipsacaceae | Cephalaria kotschyi | Ref. |
| Plantae | Dipsacaceae | Cephalaria nachiczevanica | Ref. |
| Plantae | Ericaceae | Pyrola atropurpurea | Ref. |
| Plantae | Ericaceae | Pyrola calliantha  | Ref. |
| Plantae | Ericaceae | Pyrola decorata  | Ref. |
| Plantae | Ericaceae | Pyrola elliptica | Ref. |
| Plantae | Ericaceae | Pyrola japonica  | Ref. |
| Plantae | Ericaceae | Rhododendron anthopogonoides | Ref. |
| Plantae | Ericaceae | Rhododendron dauricum  | Ref. |
| Plantae | Ericaceae | Rhododendron ferrugineum  | Ref. |
| Plantae | Ericaceae | Rhododendron micranthum | Ref. |
| Plantae | Euphorbiaceae | Croton tonkinensis GAGNEP | Ref. |
| Plantae | Euphorbiaceae | Euphorbia lunulata  | Ref. |
| Plantae | Fabaceae | Acacia melanoxylon  | Ref. |
| Plantae | Fabaceae | Acacia praecox | Ref. |
| Plantae | Fabaceae | Anthyllis onobrychioides | Ref. |
| Plantae | Fabaceae | Astragalus brachycarpus | Ref. |
| Plantae | Fabaceae | Eysenhardtia subcoriacea Pennell | Ref. |
| Plantae | Fabaceae | Hedysarum sericeum | Ref. |
| Plantae | Fabaceae | Lathyrus chrysanthus | Ref. |
| Plantae | Fabaceae | Lotus corniculatus  | Ref. |
| Plantae | Fabaceae | Lotus japonicus | Ref. |
| Plantae | Fabaceae | Onobrychis bobrovi | Ref. |
| Plantae | Fabaceae | Onobrychis vassiltschenkoi | Ref. |
| Plantae | Fabaceae | Ononis leiosperma | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Tachigalia paniculata | Ref. |
| Plantae | Fabaceae | Trifolium montanum | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Fabaceae | Trifolium repens L.  | Ref. |
| Plantae | Fumariaceae | Fumaria capreolata  | Ref. |
| Plantae | Fumariaceae | Fumaria officinalis  | Ref. |
| Plantae | Fumariaceae | Fumaria schleicheri | Ref. |
| Plantae | Fumariaceae | Fumaria vaillantii  | Ref. |
| Plantae | Geraniaceae | Geranium niveum | Ref. |
| Plantae | Geraniaceae | Geranium wilfordii | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Hypericaceae | Cratoxylum formosum ssp.pruniflorum  | Ref. |
| Plantae | Hypericaceae | Hypericum ascyron  | Ref. |
| Plantae | Hypericaceae | Hypericum barbatum Jacq.  | Ref. |
| Plantae | Hypericaceae | Hypericum curvisepalum | Ref. |
| Plantae | Hypericaceae | Hypericum elodioides | Ref. |
| Plantae | Hypericaceae | Hypericum faberi | Ref. |
| Plantae | Hypericaceae | Hypericum forrestii | Ref. |
| Plantae | Hypericaceae | Hypericum hirsutum L. | Ref. |
| Plantae | Hypericaceae | Hypericum japonicum  | Ref. |
| Plantae | Hypericaceae | Hypericum lancasteri | Ref. |
| Plantae | Hypericaceae | Hypericum linarioides BOSSE | Ref. |
| Plantae | Hypericaceae | Hypericum maculatum Crantz  | Ref. |
| Plantae | Hypericaceae | Hypericum patulum | Ref. |
| Plantae | Hypericaceae | Hypericum perforatum  | Ref. |
| Plantae | Hypericaceae | Hypericum rumeliacum BOISS. | Ref. |
| Plantae | Hypericaceae | Hypericum sampsonii | Ref. |
| Plantae | Hypericaceae | Hypericum scabrum  | Ref. |
| Plantae | Hypericaceae | Hypericum subsessile | Ref. |
| Plantae | Hypericaceae | Hypericum tetrapterum Fries  | Ref. |
| Plantae | Hypericaceae | Hypericum wightianum subsp.axillare | Ref. |
| Plantae | Iridaceae | Patersonia spp. | Ref. |
| Plantae | Labiatae | Prunella vulgaris  | Ref. |
| Plantae | Lauraceae | Cassytha filiformis  | Ref. |
| Plantae | Lauraceae | Lindera obtusiloba | Ref. |
| Plantae | Longaniaceae | Strychnos spinosa  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Abelmoschus manihot  | Ref. |
| Plantae | Malvaceae | Theobroma cacao L.  | Ref. |
| Plantae | Menyanthaceae | Menyanthes trifoliata L.  | Ref. |
| Plantae | Musaceae | Musa acuminata  | Ref. |
| Plantae | Myrsinaceae | Lysimachia mauritiana | Ref. |
| Plantae | Myrtaceae | Eucalyptus globulus  | Ref. |
| Plantae | Myrtaceae | Pimenta dioica  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Nelumbonaceae | Nelumbo nucifera  | Ref. |
| Plantae | Nymphaeaceae | Nymphaea alba  | Ref. |
| Plantae | Pinaceae | Abies amabilis | Ref. |
| Plantae | Plumbaginaceae | Ceratostigma willmottianum | Ref. |
| Plantae | Polygonaceae | Calligonum leucocladum | Ref. |
| Plantae | Polygonaceae | Eskemukerjea megacarpum HARA | Ref. |
| Plantae | Polygonaceae | Polygonum cuspidatum  | Ref. |
| Plantae | Polygonaceae | Polygonum sachalinensis | Ref. |
| Plantae | Polygonaceae | Polygonum salicifolium  | Ref. |
| Plantae | Polygonaceae | Rumex aquaticus  | Ref. |
| Plantae | Primulaceae | Primula veris  | Ref. |
| Plantae | Pteridaceae | Adiantum monochlamys | Ref. |
| Plantae | Restionaceae | Cannomois virgata | Ref. |
| Plantae | Rhamnaceae | Rhamnus disperma | Ref. |
| Plantae | Rosaceae | Agrimonia pilosa  | Ref. |
| Plantae | Rosaceae | Agrimonia pilosa var.japonica  | Ref. |
| Plantae | Rosaceae | Crataegus cuneata  | Ref. |
| Plantae | Rosaceae | Crataegus hupehensis | Ref. |
| Plantae | Rosaceae | Crataegus kansuensis | Ref. |
| Plantae | Rosaceae | Crataegus maximowiczii  | Ref. |
| Plantae | Rosaceae | Crataegus pinnatifida  | Ref. |
| Plantae | Rosaceae | Crataegus pinnatifida var.major  | Ref. |
| Plantae | Rosaceae | Crataegus pinnatifida var.psilosa  | Ref. |
| Plantae | Rosaceae | Crataegus sanguinea  | Ref. |
| Plantae | Rosaceae | Crataegus scabrifolia | Ref. |
| Plantae | Rosaceae | Parageum montanum | Ref. |
| Plantae | Rosaceae | Rosa luciae | Ref. |
| Plantae | Rosaceae | Rosa multiflora  | Ref. |
| Plantae | Rosaceae | Sanguisorba officinalis  | Ref. |
| Plantae | Rosaceae | Spiraea formosana  | Ref. |
| Plantae | Rubiaceae | Adina racemosa | Ref. |
| Plantae | Rubiaceae | Cruciata taurica | Ref. |
| Plantae | Rubiaceae | Mitragyna speciosa | Ref. |
| Plantae | Rubiaceae | Ophiorrhiza liukiuensis | Ref. |
| Plantae | Rubiaceae | Sinoadina racemosa | Ref. |
| Plantae | Rubiaceae | Uncaria hirsuta  | Ref. |
| Plantae | Rubiaceae | Uncaria rhynchophyllus | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Rutaceae | Zanthoxylum bungeanum  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Saururaceae | Saururus chinensis  | Ref. |
| Plantae | Saxifragaceae | Leptarrhena pyrolifolia | Ref. |
| Plantae | Saxifragaceae | Saxifraga stellaris | Ref. |
| Plantae | Taxodiaceae | Taxodium distichum | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Urticaceae | Boehmeria holosericea | Ref. |
| Plantae | Urticaceae | Boehmeria tricuspis | Ref. |
| - | - | Aceraceae negundo | Ref. |
| - | - | Aganosma caryophyllata | Ref. |
| - | - | Chamaenerion angustifolium | Ref. |
| - | - | Monochaetun multiflorum | Ref. |
| - | - | Oxycoccus quadripetalis | Ref. |
|
|
zoom in
| Organism | Hypericum forrestii | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Wang, et al., Handbook of Effective Components in Vegetal Medicines, People Health Press, Beijing, (1986).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Liu, et al., Shenyang Yaoke Daxue Xuebao, 20, (2003), 55.
Huang, et al., Zhiwu Xuebao, 23, (1981), 222.
Zhang, et al., Planta Med, 70, (2004), 1216.
Deachathai, et al., Phytochemistry, 67, (2006), 464.
NISHIMURA, et al., Chem Pharm Bull, 53, (2005), 305.
KITAJIMA, et al., Chem Pharm Bull, 53, (2005), 1355.
Itoh, et al., Journal of Natural Products, 66, (2003), 1212.
Kiss, et al., Planta Med, 70, (2004), 919.
Heitzman, et al., Phytochemistry, 66, (2005), 5.
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009).
Liang, et al., Chinese J of Pharm Analysis, 30, (2010), 279 |
|---|
|