| Name |
(-)-Medicarpin Medicarpin 3-Hydroxy-9-methoxypterocarpan |
| Formula |
C16H14O4 |
| Mw |
270.08920894 |
| CAS RN |
32383-76-9 |
| C_ID |
C00002547
, 
|
| InChIKey |
NSRJSISNDPOJOP-AYSIPDSENA-N |
| InChICode |
InChI=1S/C16H14O4/c1-18-10-3-5-11-13-8-19-14-6-9(17)2-4-12(14)16(13)20-15(11)7-10/h2-7,13,16-17H,8H2,1H3/t13-,16-/m0/s1 |
| SMILES |
COc1ccc2c(c1)O[C@H]1c3ccc(O)cc3OC[C@@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Convolvulaceae | Erycibe expansa  | Ref. |
| Plantae | Fabaceae | Andira inermis  | Ref. |
| Plantae | Fabaceae | Astragalus membranaceus  | Ref. |
| Plantae | Fabaceae | Astragalus mongholicus | Ref. |
| Plantae | Fabaceae | Butea monosperma  | Ref. |
| Plantae | Fabaceae | Camptosema rubicundum | Ref. |
| Plantae | Fabaceae | Canavalia bonariensis | Ref. |
| Plantae | Fabaceae | Canavalia cathartica  | Ref. |
| Plantae | Fabaceae | Canavalia eurycarpa | Ref. |
| Plantae | Fabaceae | Canavalia galeata | Ref. |
| Plantae | Fabaceae | Canavalia gladiata  | Ref. |
| Plantae | Fabaceae | Canavalia rosea  | Ref. |
| Plantae | Fabaceae | Canavalia sericea | Ref. |
| Plantae | Fabaceae | Caragana acanthophylla | Ref. |
| Plantae | Fabaceae | Caragana altaica | Ref. |
| Plantae | Fabaceae | Caragana ambigua  | Ref. |
| Plantae | Fabaceae | Caragana arborescens  | Ref. |
| Plantae | Fabaceae | Caragana aurantiaca | Ref. |
| Plantae | Fabaceae | Caragana boisii | Ref. |
| Plantae | Fabaceae | Caragana brevispina  | Ref. |
| Plantae | Fabaceae | Caragana conferta | Ref. |
| Plantae | Fabaceae | Caragana decorticans | Ref. |
| Plantae | Fabaceae | Caragana densa | Ref. |
| Plantae | Fabaceae | Caragana erinacea | Ref. |
| Plantae | Fabaceae | Caragana franchetiana | Ref. |
| Plantae | Fabaceae | Caragana frutex | Ref. |
| Plantae | Fabaceae | Caragana fruticosa | Ref. |
| Plantae | Fabaceae | Caragana gerardiana | Ref. |
| Plantae | Fabaceae | Caragana grandiflora | Ref. |
| Plantae | Fabaceae | Caragana jubata | Ref. |
| Plantae | Fabaceae | Caragana kirghisorum | Ref. |
| Plantae | Fabaceae | Caragana laeta | Ref. |
| Plantae | Fabaceae | Caragana microphylla  | Ref. |
| Plantae | Fabaceae | Caragana pekinensis | Ref. |
| Plantae | Fabaceae | Caragana pleiophylla | Ref. |
| Plantae | Fabaceae | Caragana pumila | Ref. |
| Plantae | Fabaceae | Caragana pygmaea | Ref. |
| Plantae | Fabaceae | Caragana sinica  | Ref. |
| Plantae | Fabaceae | Caragana sophorifolia | Ref. |
| Plantae | Fabaceae | Caragana spinosa | Ref. |
| Plantae | Fabaceae | Caragana stenophylla  | Ref. |
| Plantae | Fabaceae | Caragana tangutica | Ref. |
| Plantae | Fabaceae | Caragana tibetica | Ref. |
| Plantae | Fabaceae | Caragana tragacanthoides | Ref. |
| Plantae | Fabaceae | Caragana turkestanica | Ref. |
| Plantae | Fabaceae | Caragana ussuriensis | Ref. |
| Plantae | Fabaceae | Carmichaelia flagelliformis | Ref. |
| Plantae | Fabaceae | Centrolobium robustum | Ref. |
| Plantae | Fabaceae | Centrolobium sclerophyllum | Ref. |
| Plantae | Fabaceae | Cicer anatolicum | Ref. |
| Plantae | Fabaceae | Cicer bijugum | Ref. |
| Plantae | Fabaceae | Cicer chorassanicum | Ref. |
| Plantae | Fabaceae | Cicer cuneatum | Ref. |
| Plantae | Fabaceae | Cicer echinospermum | Ref. |
| Plantae | Fabaceae | Cicer macracanthum | Ref. |
| Plantae | Fabaceae | Cicer montbretii | Ref. |
| Plantae | Fabaceae | Cicer pungens | Ref. |
| Plantae | Fabaceae | Cicer rechingeri | Ref. |
| Plantae | Fabaceae | Cicer reticulatum | Ref. |
| Plantae | Fabaceae | Cicer songaricum | Ref. |
| Plantae | Fabaceae | Cicer yamashitae | Ref. |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Fabaceae | Dalbergia sericea | Ref. |
| Plantae | Fabaceae | Dalbergia stevensonii | Ref. |
| Plantae | Fabaceae | Dalbergia variabilis | Ref. |
| Plantae | Fabaceae | Echinosophora koreensis | Ref. |
| Plantae | Fabaceae | Galactia jussiaeana | Ref. |
| Plantae | Fabaceae | Galactia striata | Ref. |
| Plantae | Fabaceae | Gliricidia sepium  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza pallidiflora | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Lathyrus grandiflorus | Ref. |
| Plantae | Fabaceae | Lathyrus hirsutus | Ref. |
| Plantae | Fabaceae | Lathyrus linifolius | Ref. |
| Plantae | Fabaceae | Lathyrus tuberosus  | Ref. |
| Plantae | Fabaceae | Maackia amurensis  | Ref. |
| Plantae | Fabaceae | Medicago arabica | Ref. |
| Plantae | Fabaceae | Medicago arborea | Ref. |
| Plantae | Fabaceae | Medicago doliata | Ref. |
| Plantae | Fabaceae | Medicago falcata | Ref. |
| Plantae | Fabaceae | Medicago glomerata | Ref. |
| Plantae | Fabaceae | Medicago hypogaea | Ref. |
| Plantae | Fabaceae | Medicago intertexta | Ref. |
| Plantae | Fabaceae | Medicago littoralis | Ref. |
| Plantae | Fabaceae | Medicago lupulina  | Ref. |
| Plantae | Fabaceae | Medicago minima | Ref. |
| Plantae | Fabaceae | Medicago orbicularis  | Ref. |
| Plantae | Fabaceae | Medicago platycarpa  | Ref. |
| Plantae | Fabaceae | Medicago radiata | Ref. |
| Plantae | Fabaceae | Medicago rigidula | Ref. |
| Plantae | Fabaceae | Medicago rugosa L. | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Medicago scutellata  | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Melilotus altissimus  | Ref. |
| Plantae | Fabaceae | Melilotus dentatus | Ref. |
| Plantae | Fabaceae | Melilotus elegans | Ref. |
| Plantae | Fabaceae | Melilotus indica  | Ref. |
| Plantae | Fabaceae | Melilotus infestus | Ref. |
| Plantae | Fabaceae | Melilotus italica | Ref. |
| Plantae | Fabaceae | Melilotus messanensis | Ref. |
| Plantae | Fabaceae | Melilotus neapolitanus | Ref. |
| Plantae | Fabaceae | Melilotus polonicus | Ref. |
| Plantae | Fabaceae | Melilotus tauricus | Ref. |
| Plantae | Fabaceae | Melilotus wolgicus | Ref. |
| Plantae | Fabaceae | Millettia pachyloba | Ref. |
| Plantae | Fabaceae | Mucuna poggei | Ref. |
| Plantae | Fabaceae | Mucuna pruriens  | Ref. |
| Plantae | Fabaceae | Myroxylon balsamum  | Ref. |
| Plantae | Fabaceae | Myroxylon peruiferum  | Ref. |
| Plantae | Fabaceae | Neorautanenia amboensis | Ref. |
| Plantae | Fabaceae | Ononis alopecuroides | Ref. |
| Plantae | Fabaceae | Ononis biflora | Ref. |
| Plantae | Fabaceae | Ononis cristata | Ref. |
| Plantae | Fabaceae | Ononis fruticosa | Ref. |
| Plantae | Fabaceae | Ononis hispida | Ref. |
| Plantae | Fabaceae | Ononis minutissima | Ref. |
| Plantae | Fabaceae | Ononis mitissima | Ref. |
| Plantae | Fabaceae | Ononis natrix  | Ref. |
| Plantae | Fabaceae | Ononis oligophylla | Ref. |
| Plantae | Fabaceae | Ononis ornithopodioides | Ref. |
| Plantae | Fabaceae | Ononis pinnata | Ref. |
| Plantae | Fabaceae | Ononis pubescens | Ref. |
| Plantae | Fabaceae | Ononis pusilla | Ref. |
| Plantae | Fabaceae | Ononis reclinata | Ref. |
| Plantae | Fabaceae | Ononis rotundifolia | Ref. |
| Plantae | Fabaceae | Ononis serrata | Ref. |
| Plantae | Fabaceae | Ononis speciosa | Ref. |
| Plantae | Fabaceae | Ononis spinosa  | Ref. |
| Plantae | Fabaceae | Ononis subspicata | Ref. |
| Plantae | Fabaceae | Ononis variegata | Ref. |
| Plantae | Fabaceae | Ononis viscosa subsp. breviflora  | Ref. |
| Plantae | Fabaceae | Pericopsis angolensis  | Ref. |
| Plantae | Fabaceae | Platymiscium trinitatis | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Swartzia madagascariensis  | Ref. |
| Plantae | Fabaceae | Taverniera abyssinica  | Ref. |
| Plantae | Fabaceae | Tephrosia purpurea  | Ref. |
| Plantae | Fabaceae | Tephrosia villosa  | Ref. |
| Plantae | Fabaceae | Trifolium africanum | Ref. |
| Plantae | Fabaceae | Trifolium alexandrinum | Ref. |
| Plantae | Fabaceae | Trifolium alpestre | Ref. |
| Plantae | Fabaceae | Trifolium alpinum  | Ref. |
| Plantae | Fabaceae | Trifolium ambiguum | Ref. |
| Plantae | Fabaceae | Trifolium angulatum | Ref. |
| Plantae | Fabaceae | Trifolium angustifolium  | Ref. |
| Plantae | Fabaceae | Trifolium apertum | Ref. |
| Plantae | Fabaceae | Trifolium bivonae | Ref. |
| Plantae | Fabaceae | Trifolium bocconei | Ref. |
| Plantae | Fabaceae | Trifolium bullatum | Ref. |
| Plantae | Fabaceae | Trifolium burchellianum | Ref. |
| Plantae | Fabaceae | Trifolium canescens | Ref. |
| Plantae | Fabaceae | Trifolium cernuum | Ref. |
| Plantae | Fabaceae | Trifolium cherleri | Ref. |
| Plantae | Fabaceae | Trifolium clusii | Ref. |
| Plantae | Fabaceae | Trifolium clypeatum | Ref. |
| Plantae | Fabaceae | Trifolium congestum | Ref. |
| Plantae | Fabaceae | Trifolium dalmaticum | Ref. |
| Plantae | Fabaceae | Trifolium dasyurum | Ref. |
| Plantae | Fabaceae | Trifolium dichroanthum | Ref. |
| Plantae | Fabaceae | Trifolium diffusum | Ref. |
| Plantae | Fabaceae | Trifolium echinatum | Ref. |
| Plantae | Fabaceae | Trifolium eriosphaerum | Ref. |
| Plantae | Fabaceae | Trifolium fragiferum | Ref. |
| Plantae | Fabaceae | Trifolium fucatum | Ref. |
| Plantae | Fabaceae | Trifolium glanduliferum | Ref. |
| Plantae | Fabaceae | Trifolium globosum | Ref. |
| Plantae | Fabaceae | Trifolium glomeratum | Ref. |
| Plantae | Fabaceae | Trifolium heldreichianum | Ref. |
| Plantae | Fabaceae | Trifolium hirtum | Ref. |
| Plantae | Fabaceae | Trifolium incarnatum | Ref. |
| Plantae | Fabaceae | Trifolium isthmocarpum | Ref. |
| Plantae | Fabaceae | Trifolium lappaceum | Ref. |
| Plantae | Fabaceae | Trifolium ligusticum | Ref. |
| Plantae | Fabaceae | Trifolium lupinaster | Ref. |
| Plantae | Fabaceae | Trifolium masaiense | Ref. |
| Plantae | Fabaceae | Trifolium medium | Ref. |
| Plantae | Fabaceae | Trifolium michelianum | Ref. |
| Plantae | Fabaceae | Trifolium miegeanum | Ref. |
| Plantae | Fabaceae | Trifolium montanum | Ref. |
| Plantae | Fabaceae | Trifolium mutabile | Ref. |
| Plantae | Fabaceae | Trifolium nigrescens | Ref. |
| Plantae | Fabaceae | Trifolium noricum | Ref. |
| Plantae | Fabaceae | Trifolium obscurum | Ref. |
| Plantae | Fabaceae | Trifolium ochroleucon | Ref. |
| Plantae | Fabaceae | Trifolium ornithopodioides | Ref. |
| Plantae | Fabaceae | Trifolium palaestinum | Ref. |
| Plantae | Fabaceae | Trifolium pallescens | Ref. |
| Plantae | Fabaceae | Trifolium pallidum | Ref. |
| Plantae | Fabaceae | Trifolium pannonicum  | Ref. |
| Plantae | Fabaceae | Trifolium parnassii | Ref. |
| Plantae | Fabaceae | Trifolium parryi | Ref. |
| Plantae | Fabaceae | Trifolium patulum | Ref. |
| Plantae | Fabaceae | Trifolium pauciflorum | Ref. |
| Plantae | Fabaceae | Trifolium phleoides | Ref. |
| Plantae | Fabaceae | Trifolium physodes | Ref. |
| Plantae | Fabaceae | Trifolium pignantii | Ref. |
| Plantae | Fabaceae | Trifolium plebeium | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Fabaceae | Trifolium purpureum | Ref. |
| Plantae | Fabaceae | Trifolium repens  | Ref. |
| Plantae | Fabaceae | Trifolium resupinatum | Ref. |
| Plantae | Fabaceae | Trifolium retusum | Ref. |
| Plantae | Fabaceae | Trifolium rubens | Ref. |
| Plantae | Fabaceae | Trifolium rueppellianum | Ref. |
| Plantae | Fabaceae | Trifolium salmoneum | Ref. |
| Plantae | Fabaceae | Trifolium saxatile | Ref. |
| Plantae | Fabaceae | Trifolium scabrum | Ref. |
| Plantae | Fabaceae | Trifolium semipilosum | Ref. |
| Plantae | Fabaceae | Trifolium spumosum | Ref. |
| Plantae | Fabaceae | Trifolium squamosum | Ref. |
| Plantae | Fabaceae | Trifolium stellatum | Ref. |
| Plantae | Fabaceae | Trifolium striatum | Ref. |
| Plantae | Fabaceae | Trifolium subterraneum  | Ref. |
| Plantae | Fabaceae | Trifolium suffocatum | Ref. |
| Plantae | Fabaceae | Trifolium sylvaticum | Ref. |
| Plantae | Fabaceae | Trifolium tenuifolium | Ref. |
| Plantae | Fabaceae | Trifolium thalii | Ref. |
| Plantae | Fabaceae | Trifolium tomentosum | Ref. |
| Plantae | Fabaceae | Trifolium trichocephalum | Ref. |
| Plantae | Fabaceae | Trifolium tumens | Ref. |
| Plantae | Fabaceae | Trifolium uniflorum | Ref. |
| Plantae | Fabaceae | Trifolium usambarense | Ref. |
| Plantae | Fabaceae | Trifolium vavilovii | Ref. |
| Plantae | Fabaceae | Trifolium vesiculosum | Ref. |
| Plantae | Fabaceae | Trifolium willdenovii | Ref. |
| Plantae | Fabaceae | Trifolium wormskioldii  | Ref. |
| Plantae | Fabaceae | Trigonella spp. | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Fabaceae | Vigna unguiculata  | Ref. |
| Plantae | Myristicaceae | Osteophloeum spp. | Ref. |
| Plantae | Taxaceae | Taxus fuana | Ref. |
| Plantae | Taxaceae | Taxus yunnanensis | Ref. |
| - | - | Osteophleum platyspermum | Ref. |
| - | - | Swertzia madagascariensis | Ref. |
|
|
zoom in
| Organism | Medicago lupulina | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|