| Name |
beta-Phellandrene beta-Phellendrene (+/-)-beta-Phellandrene |
| Formula |
C10H16 |
| Mw |
136.12520051 |
| CAS RN |
555-10-2 |
| C_ID |
C00010872
, 
|
| InChIKey |
LFJQCDVYDGGFCH-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,6,8,10H,3,5,7H2,1-2H3/t10-/m1/s1 |
| SMILES |
C=C1C=CC(C(C)C)CC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Anacardiaceae | Schinus terebinthus | Ref. |
| Plantae | Annonaceae | Annona squamosa  | Ref. |
| Plantae | Annonaceae | Monodora myristica  | Ref. |
| Plantae | Annonaceae | Xylopia aethiopica  | Ref. |
| Plantae | Annonaceae | Xylopia parviflora  | Ref. |
| Plantae | Apiaceae | Angelica dahurica  | Ref. |
| Plantae | Apiaceae | Angelica sinensis  | Ref. |
| Plantae | Apiaceae | Angelica spp. | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apiaceae | Petroselinum crispum  | Ref. |
| Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
| Plantae | Asteraceae | Artemisia grandis | Ref. |
| Plantae | Asteraceae | Chamaemelum nobile  | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Asteraceae | Phagnalon sordidum | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Asteraceae | Santolina corsica Jordan et Fourr | Ref. |
| Plantae | Asteraceae | Senecio vulgaris  | Ref. |
| Plantae | Canellaceae | Canella winterana  | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Cistaceae | Cistus albidus | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Crassulaceae | Rhodiola rosea L.  | Ref. |
| Plantae | Fagaceae | Quercus coccifera  | Ref. |
| Plantae | Geraniaceae | Pelargonium graveolens  | Ref. |
| Plantae | Illiciaceae | Illicium anisatum  | Ref. |
| Plantae | Labiatae | Clinopodium nepeta | Ref. |
| Plantae | Labiatae | Lavandula angustifolia  | Ref. |
| Plantae | Labiatae | Lavandula spp. | Ref. |
| Plantae | Labiatae | Lavandula stoechas  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Labiatae | Thymus eriocalyx | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
| Plantae | Labiatae | Thymus X-porlock | Ref. |
| Plantae | Labiatae | Trichostema lanceolatum | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
| Plantae | Malvaceae | Gossypium sturtianum var.nandewarence | Ref. |
| Plantae | Myrtaceae | Eucalyptus globulus  | Ref. |
| Plantae | Myrtaceae | Eucalyptus spp.  | Ref. |
| Plantae | Myrtaceae | Myrtus communis  | Ref. |
| Plantae | Oleaceae | Forsythia suspensa  | Ref. |
| Plantae | Pinaceae | Cedrus libani  | Ref. |
| Plantae | Pinaceae | Larix sibirica | Ref. |
| Plantae | Pinaceae | Picea ajanensis | Ref. |
| Plantae | Pinaceae | Picea obovata | Ref. |
| Plantae | Pinaceae | Picea schrenkiana | Ref. |
| Plantae | Pinaceae | Pinus halepensis  | Ref. |
| Plantae | Pinaceae | Pinus kesiya | Ref. |
| Plantae | Pinaceae | Pinus mugo subsp. Mugo  | Ref. |
| Plantae | Pinaceae | Pinus sibirica L. | Ref. |
| Plantae | Pinaceae | Pinus spp.  | Ref. |
| Plantae | Pinaceae | Pinus sylvestris L.  | Ref. |
| Plantae | Pinaceae | Pinus taeda | Ref. |
| Plantae | Piperaceae | Piper arboreum  | Ref. |
| Plantae | Piperaceae | Piper fimbriulatum | Ref. |
| Plantae | Piperaceae | Piper nigrum  | Ref. |
| Plantae | Plagiochilaceae | Plagiochila standleyi | Ref. |
| Plantae | Poaceae | Cymbopogon flexuosus  | Ref. |
| Plantae | Rutaceae | Atalantia guillauminii | Ref. |
| Plantae | Rutaceae | Citrus aurantium  | Ref. |
| Plantae | Rutaceae | Citrus grandis  | Ref. |
| Plantae | Rutaceae | Citrus latifolia  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus medica  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Citrus sinki x Poncirus trifoliata | Ref. |
| Plantae | Rutaceae | Clausena excavata  | Ref. |
| Plantae | Rutaceae | Poncirus trifoliate x Citrus sinensis | Ref. |
| Plantae | Rutaceae | Poncirus trioliata | Ref. |
| Plantae | Rutaceae | Zanthoxylum armatum  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| Plantae | Zingiberaceae | Curcuma amada  | Ref. |
| Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Curcuma mangga  | Ref. |
| Plantae | Zingiberaceae | Kaempferia galanga  | Ref. |
| Plantae | Zingiberaceae | Zingiber cassumunar Roxb.  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Angelica | Ref. |
| - | - | Eucalyptus | Ref. |
| - | - | Lavandula | Ref. |
| - | - | Mentha | Ref. |
| - | - | Trachyspermum roxburghianum  | Ref. |
|
|
zoom in
| Organism | Kaempferia galanga | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Hua, et al., Nanjing Zhongyi Xuexuan Xiuebao, 6, (1990), 179 |
|---|
|