| Name |
3beta-Acetoxytropane O-Acetylpseudotropine |
| Formula |
C10H17NO2 |
| Mw |
183.12592879 |
| CAS RN |
3423-26-5 |
| C_ID |
C00025556
, 
|
| InChIKey |
MDIDMOWWLBGYPG-ILWJIGKKNA-N |
| InChICode |
InChI=1S/C10H17NO2/c1-7(12)13-10-5-8-3-4-9(6-10)11(8)2/h8-10H,3-6H2,1-2H3/t8-,9+,10- |
| SMILES |
CC(=O)O[C@@H]1C[C@H]2CC[C@@H](C1)N2C |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Arg L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Solanaceae | Datura candida X candida  | Ref. |
| Plantae | Solanaceae | Datura innoxia Mill  | Ref. |
| Plantae | Solanaceae | Datura metel L.var.fastuga  | Ref. |
| Plantae | Solanaceae | Datura sanguinea Ruiz.et Pav. | Ref. |
| Plantae | Solanaceae | Datura wrightii Regel | Ref. |
| Plantae | Solanaceae | Hyoscyamus albus L.  | Ref. |
| Plantae | Solanaceae | Hyoscyamus boveanus | Ref. |
| Plantae | Solanaceae | Hyoscyamus desertorum | Ref. |
| Plantae | Solanaceae | Hyoscyamus muticus  | Ref. |
| Plantae | Solanaceae | Hyoscyamus pusillus L. | Ref. |
| Plantae | Solanaceae | Physalis peruviana L.  | Ref. |
|
|
zoom in
| Organism | Hyoscyamus muticus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|