| Name |
Coreopsin |
| Formula |
C21H22O10 |
| Mw |
434.12129692 |
| CAS RN |
499-29-6 |
| C_ID |
C00007218
, 
|
| InChIKey |
QMVODIKHHIRSGI-KTSMLEKGNA-N |
| InChICode |
InChI=1S/C21H22O10/c22-9-17-18(27)19(28)20(29)21(31-17)30-11-3-4-12(15(25)8-11)13(23)5-1-10-2-6-14(24)16(26)7-10/h1-8,17-22,24-29H,9H2/b5-1+/t17-,18+,19-,20-,21+/m0/s1 |
| SMILES |
O=C(/C=C/c1ccc(O)c(O)c1)c1ccc(O[C@@H]2OC(CO)[C@@H](O)[C@H](O)C2O)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Baeria chrysostoma | Ref. |
| Plantae | Asteraceae | Bidens spp. | Ref. |
| Plantae | Asteraceae | Coreopsis bigelovii | Ref. |
| Plantae | Asteraceae | Coreopsis gigantea | Ref. |
| Plantae | Asteraceae | Coreopsis maritima | Ref. |
| Plantae | Asteraceae | Cosmos sulphureus | Ref. |
| Plantae | Asteraceae | Dahlia variabilis  | Ref. |
| Plantae | Asteraceae | Simsia spp. | Ref. |
| Plantae | Asteraceae | Viguiera multiflora | Ref. |
| Plantae | Fabaceae | Butea monosperma  | Ref. |
| Plantae | Fabaceae | Cassia roxburghii | Ref. |
| Plantae | Pinaceae | Abies pindrow  | Ref. |
|
|
zoom in
| Organism | Viguiera multiflora | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 115,Chalcones,dihydrochalcones and aurones
Geissman,J.Am.Chem.Soc.,78,(1956),825
Gupta,Phytochem.,9,(1970),2231 |
|---|
|