| Name |
Onopordin 5,7,3',4'-Tetrahydroxy-8-methoxyflavone 8-Methoxyluteolin 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-8-methoxy-4H-1-benzopyran-4-one |
| Formula |
C16H12O7 |
| Mw |
316.05830274 |
| CAS RN |
5916-04-1 |
| C_ID |
C00003907
, 
|
| InChIKey |
FPSMUVCMXQTXND-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O7/c1-22-15-12(21)5-10(19)14-11(20)6-13(23-16(14)15)7-2-3-8(17)9(18)4-7/h2-6,17-19,21H,1H3 |
| SMILES |
COc1c(O)cc(O)c2c(=O)cc(-c3ccc(O)c(O)c3)oc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Centaurea chilensis | Ref. |
| Plantae | Asteraceae | Doronicum grandiflorum | Ref. |
| Plantae | Asteraceae | Madia spp. | Ref. |
| Plantae | Asteraceae | Onopordum acanthium  | Ref. |
| Plantae | Asteraceae | Onopordum laconicum | Ref. |
| Plantae | Asteraceae | Viguiera decurrens | Ref. |
| Plantae | Asteraceae | Wilkesia hobdyi | Ref. |
| Plantae | Rubiaceae | Gardenia gummifera  | Ref. |
| Plantae | Rubiaceae | Gardenia lucida | Ref. |
|
|
zoom in
| Organism | Gardenia lucida | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Bogs,Pharmazie,20,(1965),706
Bohm,Phytochem.,29,(1990),1175 |
|---|
|