| Name |
Kaempferol 3-rutinoside Nicotiflorin Nicotifloroside Kaempferol 3-O-rutinoside Kaempferol 3-O-(alpha-L-rhamnopyranosyl(1->6)-beta-D-glucopyranoside (-)-Kaempferol 3-O-(alpha-L-rhamnopyranosyl(1->6)-beta-D-glucopyranoside |
| Formula |
C27H30O15 |
| Mw |
594.15847029 |
| CAS RN |
17650-84-9 |
| C_ID |
C00005169
, 
|
| InChIKey |
RTATXGUCZHCSNG-FBSNBPALNA-N |
| InChICode |
InChI=1S/C27H30O15/c1-9-17(31)20(34)22(36)26(39-9)38-8-15-18(32)21(35)23(37)27(41-15)42-25-19(33)16-13(30)6-12(29)7-14(16)40-24(25)10-2-4-11(28)5-3-10/h2-7,9,15,17-18,20-23,26-32,34-37H,8H2,1H3/t9-,15-,17-,18+,20-,21-,22+,23+,26+,27-/m0/s1 |
| SMILES |
CC1O[C@@H](OCC2O[C@@H](Oc3c(-c4ccc(O)cc4)oc4cc(O)cc(O)c4c3=O)C(O)C(O)[C@@H]2O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Agavaceae | Agave americana var.marginata  | Ref. |
| Plantae | Annonaceae | Annona muricata  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apiaceae | Tordylium apulum  | Ref. |
| Plantae | Aristolochiaceae | Aristolochia kaempferi | Ref. |
| Plantae | Asteraceae | Carthamus tinctorius  | Ref. |
| Plantae | Asteraceae | Centaurea hierapolitana | Ref. |
| Plantae | Asteraceae | Clibadium spp. | Ref. |
| Plantae | Asteraceae | Conyza filaginoides | Ref. |
| Plantae | Asteraceae | Desmanthodium spp. | Ref. |
| Plantae | Asteraceae | Montanoa tomentosa | Ref. |
| Plantae | Asteraceae | Scorzonera divaricata | Ref. |
| Plantae | Asteraceae | Silphium perfoliatum L. | Ref. |
| Plantae | Asteraceae | Solidago altissima | Ref. |
| Plantae | Boraginaceae | Alkanna orientalis | Ref. |
| Plantae | Bromeliaceae | Pitcairnia spp. | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Capparaceae | Capparis spinosa L.  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Caryophyllaceae | Dianthus caryophyllus  | Ref. |
| Plantae | Cistaceae | Cistus ladaniferus  | Ref. |
| Plantae | Convolvulaceae | Calystegia japonica  | Ref. |
| Plantae | Crassulaceae | Rhodiola rosea  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Capsella bursa-pastoris  | Ref. |
| Plantae | Cupressaceae | Juniperus communis var.depressa  | Ref. |
| Plantae | Dennstaedtiaceae | Paesia anfractuosa | Ref. |
| Plantae | Dioscoreaceae | Dioscorea alata  | Ref. |
| Plantae | Ebenaceae | Diospyros rhombifolia | Ref. |
| Plantae | Equisetaceae | Equisetum silvaticum | Ref. |
| Plantae | Eucommiaceae | Eucommia ulmoides Oliv.  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia geniculata | Ref. |
| Plantae | Euphorbiaceae | Euphorbia larica | Ref. |
| Plantae | Euphorbiaceae | Euphorbia magalanta | Ref. |
| Plantae | Euphorbiaceae | Euphorbia virgata | Ref. |
| Plantae | Euphorbiaceae | Ricinus communis  | Ref. |
| Plantae | Fabaceae | Bauhinia candicans | Ref. |
| Plantae | Fabaceae | Cassia hirsuta  | Ref. |
| Plantae | Fabaceae | Cassia spp. | Ref. |
| Plantae | Fabaceae | Clitoria ternata | Ref. |
| Plantae | Fabaceae | Clitoria ternatea  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Styphnolobium japonicum | Ref. |
| Plantae | Fumariaceae | Fumaria parviflora  | Ref. |
| Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Labiatae | Marrubium velutinum | Ref. |
| Plantae | Limnanthaceae | Limnanthes douglasii | Ref. |
| Plantae | Longaniaceae | Strychnos spinosa  | Ref. |
| Plantae | Malvaceae | Kleinhovia hospita  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrine | Ref. |
| Plantae | Moringaceae | Moringa stenopetala  | Ref. |
| Plantae | Nymphaeaceae | Nymphaea candida  | Ref. |
| Plantae | Oleaceae | Fraxinus oxycarba | Ref. |
| Plantae | Oleaceae | Nyctanthes arbortristis  | Ref. |
| Plantae | Oleaceae | Nyctanthes arbor-tristis Linn.  | Ref. |
| Plantae | Pinaceae | Abies amabilis | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Poaceae | Cymbopogon citratus  | Ref. |
| Plantae | Pteridaceae | Adiantum capillus-veneris  | Ref. |
| Plantae | Rhamnaceae | Colubrina asiatica  | Ref. |
| Plantae | Rhizophoraceae | Bruguiera sexangula var.rhynchopetala | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rubiaceae | Hedyotis herbacea | Ref. |
| Plantae | Rubiaceae | Morinda citrifolia  | Ref. |
| Plantae | Rubiaceae | Morinda morindoides | Ref. |
| Plantae | Rubiaceae | Sinoadina Racemosa | Ref. |
| Plantae | Rubiaceae | Spermacoce laevis Roxb. | Ref. |
| Plantae | Ruscaceae | Ruscus hypoglossum L.  | Ref. |
| Plantae | Saxifragaceae | Leptarrhena pyrolifolia | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Leucophysalis spp. | Ref. |
| Plantae | Solanaceae | Nicotiana spp. | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Physalis peruviana  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Thymelaeaceae | Edgeworthia chrysantha | Ref. |
| Plantae | Urticaceae | Boehmeria holosericea | Ref. |
| Plantae | Urticaceae | Boehmeria tricuspis | Ref. |
| Plantae | Urticaceae | Urtica dioica  | Ref. |
| Plantae | Zygophyllaceae | Tribulus terrestris  | Ref. |
| Plantae | Zygophyllaceae | Tribulus terrstris | Ref. |
|
|
zoom in
| Organism | Sinoadina Racemosa | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Xing, et al., CCMM, 28, (2003), 593.
Itoh, et al., JNP, 67, (2004), 427.
Tang, et al., JNP, 64, (2001), 1107.
FURUSAWA, et al., Chem Pharm Bull, 53, (2005), 591.
Tang, et al., Phytochemistry, 58, (2001), 1251 |
|---|
|