| Name |
Aloenin |
| Formula |
C19H22O10 |
| Mw |
410.12129692 |
| CAS RN |
38412-46-3 |
| C_ID |
C00064312
|
| InChIKey |
KFJNVVJUICKJEQ-LQDZTQBFSA-N |
| InChICode |
InChI=1S/C19H22O10/c1-8-3-9(21)4-11(15(8)12-5-10(26-2)6-14(22)27-12)28-19-18(25)17(24)16(23)13(7-20)29-19/h3-6,13,16-21,23-25H,7H2,1-2H3/t13-,16-,17+,18-,19-/m1/s1 |
| SMILES |
COc1cc(-c2c(C)cc(O)cc2OC2OC(CO)C(O)C(O)C2O)oc(=O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Aloe arborescens  | Ref. |
| Plantae | Asphodelaceae | Aloe barbadensis  | Ref. |
| Plantae | Asphodelaceae | Aloe elgonica | Ref. |
| Plantae | Asphodelaceae | Aloe marlothii  | Ref. |
| Plantae | Asphodelaceae | Aloe nyeriensis | Ref. |
| Plantae | Asphodelaceae | Aloe nyeriensis var. kedongensis | Ref. |
| Plantae | Asphodelaceae | Aloe striata | Ref. |
| Plantae | Asphodelaceae | Aloe vera var. chinensis  | Ref. |
|
|
zoom in
| Organism | Aloe vera var. chinensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|