| Name |
Skimmin (-)-Skimmin |
| Formula |
C15H16O8 |
| Mw |
324.08451749 |
| CAS RN |
93-39-0 |
| C_ID |
C00032165
, 
|
| InChIKey |
VPAOSFFTKWUGAD-TYKRLAFXNA-N |
| InChICode |
InChI=1S/C15H16O8/c16-6-10-12(18)13(19)14(20)15(23-10)21-8-3-1-7-2-4-11(17)22-9(7)5-8/h1-5,10,12-16,18-20H,6H2/t10-,12+,13+,14-,15-/m1/s1 |
| SMILES |
O=c1ccc2ccc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc2o1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Glehnia littoralis  | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Saussurea tridactyla var.maidugonla | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cupressaceae | Juniperus phoenicea  | Ref. |
| Plantae | Hydrangeaceae | Pileostegia viburnoides var. glabrescens | Ref. |
| Plantae | Moraceae | Morus alba L.  | Ref. |
| Plantae | Rutaceae | Aegle marmelos  | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Rutaceae | Skimmia japonica | Ref. |
| Plantae | Rutaceae | Skimmia laureola | Ref. |
| Plantae | Rutaceae | Skimmia reevesiana | Ref. |
| Plantae | Thymelaeaceae | Stellera chamaejasme L.  | Ref. |
|
|
zoom in
| Organism | Aegle marmelos | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|