| Name |
Isocorynoxeine |
| Formula |
C22H26N2O4 |
| Mw |
382.18925733 |
| CAS RN |
51014-29-0 |
| C_ID |
C00031895
, 
|
| InChIKey |
MUVGVMUWMAGNSY-WJTBOIINNA-N |
| InChICode |
InChI=1S/C22H26N2O4/c1-4-14-12-24-10-9-22(17-7-5-6-8-18(17)23-21(22)26)19(24)11-15(14)16(13-27-2)20(25)28-3/h4-8,13-15,19H,1,9-12H2,2-3H3,(H,23,26)/b16-13+/t14-,15-,19-,22-/m0/s1 |
| SMILES |
C=C[C@H]1CN2CC[C@@]3(C(=O)Nc4ccccc43)[C@@H]2C[C@@H]1/C(=COC)C(=O)OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp Secologanin |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rubiaceae | Mitragyna africanus WILLD. | Ref. |
| Plantae | Rubiaceae | Mitragyna speciosa | Ref. |
| Plantae | Rubiaceae | Uncaria attenuata | Ref. |
| Plantae | Rubiaceae | Uncaria borneensis | Ref. |
| Plantae | Rubiaceae | Uncaria lanosa | Ref. |
| Plantae | Rubiaceae | Uncaria longiflora | Ref. |
| Plantae | Rubiaceae | Uncaria rhynchophylla  | Ref. |
| Plantae | Rubiaceae | Uncaria rhynchophyllus | Ref. |
| Plantae | Rubiaceae | Uncaria sinensis | Ref. |
|
|
zoom in
| Organism | Uncaria rhynchophyllus |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Heitzman, et al., Phytochemistry, 66, (2005), 5 |
|---|
|
