| Name |
Songoramine Zongoramine |
| Formula |
C22H29NO3 |
| Mw |
355.2147438 |
| CAS RN |
23179-78-4 |
| C_ID |
C00024959
, 
|
| InChIKey |
YSSPOBAEOOLGAT-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C22H29NO3/c1-4-23-17-12-7-14-20(3)6-5-16(26-19(20)23)22(14,17)15-8-13(24)11-9-21(12,15)18(25)10(11)2/h11-12,14-19,25H,2,4-9H2,1,3H3/t11-,12-,14+,15-,16-,17+,18+,19+,20+,21+,22-/m1/s1 |
| SMILES |
C=C1C2CC3(C1O)C1CC4C5(C)CCC6OC5N(CC)C1C64C3CC2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Arg Cholesterol |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ranunculaceae | Aconitum carmichaeli Debx  | Ref. |
| Plantae | Ranunculaceae | Aconitum karakolicum | Ref. |
| Plantae | Ranunculaceae | Aconitum monticola | Ref. |
| Plantae | Ranunculaceae | Aconitum napellus L.ssp.vulgare  | Ref. |
| Plantae | Ranunculaceae | Aconitum soongaricum | Ref. |
| Plantae | Ranunculaceae | Aconitum soongoricum | Ref. |
| - | - | Acotinum carmichaeli | Ref. |
| - | - | Acotinum nagarum var.lasiandrum | Ref. |
|
|
zoom in
| Organism | Acotinum nagarum var.lasiandrum | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Wang, et al., ZYZ, 31, (1996), 74 |
|---|
|