| Name |
Noracronycine |
| Formula |
C19H17NO3 |
| Mw |
307.12084342 |
| CAS RN |
13161-79-0 |
| C_ID |
C00024269
, 
|
| InChIKey |
CBXBWBNEFPNSDO-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H17NO3/c1-19(2)9-8-12-15(23-19)10-14(21)16-17(12)20(3)13-7-5-4-6-11(13)18(16)22/h4-10,21H,1-3H3 |
| SMILES |
Cn1c2ccccc2c(=O)c2c(O)cc3c(c21)C=CC(C)(C)O3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
Anthranilate L-Ala |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rutaceae | Acronychia baueri | Ref. |
| Plantae | Rutaceae | Boenninghausenia albiflora  | Ref. |
| Plantae | Rutaceae | Glycosmis citrifolia | Ref. |
| Plantae | Rutaceae | Glycosmis mauritiana | Ref. |
| Plantae | Rutaceae | Glycosmis pentalhylla | Ref. |
| Plantae | Rutaceae | Glycosmis pentaphylla  | Ref. |
| Plantae | Rutaceae | Medicosma subsessilis | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Rutaceae | Sarcomelicope megistophylla | Ref. |
|
|
zoom in
| Organism | Murraya paniculata | | Reference | Xie, et al., Chapter 28, JIU LI XIANG, in Modern Stydies of Chinese Herbal Medicine, edited. By Institute of Materia Medica, Chinese Academy of Medical Sciences, Vol.2, 333-61, Union Press of Beijing Medical University and Peking Union Medical College, Geijing, (1996) |
|---|
|