| Name |
Clionasterol gamma-Sitosterol |
| Formula |
C29H50O |
| Mw |
414.38616622 |
| CAS RN |
83-47-6 |
| C_ID |
C00023769
, 
|
| InChIKey |
KZJWDPNRJALLNS-XNMQMIFBNA-N |
| InChICode |
InChI=1S/C29H50O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h10,19-21,23-27,30H,7-9,11-18H2,1-6H3/t20-,21+,23+,24+,25-,26+,27+,28+,29-/m1/s1 |
| SMILES |
CC[C@@H](CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Amoebozoa | Physaridae | Physarum flavicomum | Ref. |
| Amoebozoa | Physaridae | Physarum polycephalum | Ref. |
| Chromalveolata | Heterosigmataceae | Heterosigma akashiwo | Ref. |
| Plantae | Acoraceae | Acorus calanus L. | Ref. |
| Plantae | Apiaceae | Peucedanum rubricaule | Ref. |
| Plantae | Asteraceae | Gynura segetum | Ref. |
| Plantae | Cruciferae | Isatis indigotica  | Ref. |
| Plantae | Malvaceae | Abutilon indicum  | Ref. |
| Plantae | Polygonaceae | Polygonum bistorta  | Ref. |
| Plantae | Rutaceae | Aegle marmelos  | Ref. |
| Plantae | Rutaceae | Citrus limonia  | Ref. |
| Plantae | Verbenaceae | Clerodendron cyrtophyllum | Ref. |
| - | - | Chloromorum toxicum | Ref. |
|
|
zoom in
| Organism | Abutilon indicum | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|