| Name |
Mansonone E |
| Formula |
C15H14O3 |
| Mw |
242.09429431 |
| CAS RN |
5090-87-9 |
| C_ID |
C00020121
, 
|
| InChIKey |
SYWTYRLIJCHSLJ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C15H14O3/c1-7-4-5-10-8(2)6-18-15-9(3)13(16)14(17)11(7)12(10)15/h4-5,8H,6H2,1-3H3/t8-/m0/s1 |
| SMILES |
CC1=C2OCC(C)c3ccc(C)c(c32)C(=O)C1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Malvaceae | Helicteres angustifolia  | Ref. |
| Plantae | Malvaceae | Hibiscus taiwanensis | Ref. |
| Plantae | Malvaceae | Mansonia altissima | Ref. |
| Plantae | Malvaceae | Thespesia populnea L. Soland. Ex Coor  | Ref. |
| Plantae | Ulmaceae | Ulmus davidiana | Ref. |
| Plantae | Ulmaceae | Ulmus laciniata | Ref. |
| Plantae | Ulmaceae | Ulmus parviflora | Ref. |
| Plantae | Ulmaceae | Ulmus parvifolia | Ref. |
|
|
zoom in
| Organism | Ulmus parvifolia | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Neelakantas, et al., Indian J Chem Sec B Org Chem Med Chem, 22B, (1983), 95.
Wu, et al., Chem Pharm Bull, 53, (2005), 56 |
|---|
|