| Name |
Senegalensin |
| Formula |
C25H26O6 |
| Mw |
422.17293856 |
| CAS RN |
139051-61-9 |
| C_ID |
C00009945
, 
|
| InChIKey |
KQLMUJOKBRYEHR-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C25H26O6/c1-13(2)5-10-16-21(27)20-22(28)18(14-6-8-15(26)9-7-14)12-30-24(20)17-11-19(25(3,4)29)31-23(16)17/h5-9,12,19,26-27,29H,10-11H2,1-4H3/t19-/m1/s1 |
| SMILES |
CC(C)=CCc1c2c(c3occ(-c4ccc(O)cc4)c(=O)c3c1O)CC(C(C)(C)O)O2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Bupleurum scorzonerifolium  | Ref. |
| Plantae | Asphodelaceae | Aloe vera  | Ref. |
| Plantae | Convolvulaceae | Erycibe expansa  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum ulei | Ref. |
| Plantae | Fabaceae | Cicer arietinum  | Ref. |
| Plantae | Fabaceae | Derris scandens  | Ref. |
| Plantae | Fabaceae | Erythrina senegalensis  | Ref. |
| Plantae | Fabaceae | Erythrina suberosa var. glabrescences  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Psoralea corylifolia  | Ref. |
| Plantae | Fabaceae | Pterocarpus marsupium  | Ref. |
| Plantae | Fabaceae | Pueraria lobata  | Ref. |
| Plantae | Fabaceae | Pueraria tuberosa  | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Fabaceae | Vigna radiata  | Ref. |
| Plantae | Moraceae | Cudrania tricuspidata  | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| - | - | Sarcolobus globosus | Ref. |
|
|
zoom in
| Organism | Erythrina senegalensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Wandji,J.Nat.Prod.,53,(1990),1425 |
|---|
|