| Name |
Quercetin 3-sophoroside-7-glucoside 2-(3,4-Dihydroxyphenyl)-3-[(2-O-beta-D-glucopyranosyl-beta-D-glucopyranosyl)oxy]-7-(beta-D-glucopyranosyloxy)-5-hydroxy-4H-1-benzopyran-4-one Quercetin 3-sophoroside-7-glucoside2-(3,4-Dihydroxyphenyl)-3-[(2-O-beta-D-glucopyranosyl-beta-D-glucopyranosyl)oxy]-7-(beta-D-glucopyranosyloxy)-5-hydroxy-4H-1-benzopyran-4-one |
| Formula |
C33H40O22 |
| Mw |
788.20112297 |
| CAS RN |
42903-93-5 |
| C_ID |
C00005464
, 
|
| InChIKey |
MSUZWPXKWROYDK-YIRMBCKDNA-N |
| InChICode |
InChI=1S/C33H40O22/c34-6-15-19(40)23(44)26(47)31(51-15)49-10-4-13(39)18-14(5-10)50-28(9-1-2-11(37)12(38)3-9)29(22(18)43)54-33-30(25(46)21(42)17(8-36)53-33)55-32-27(48)24(45)20(41)16(7-35)52-32/h1-5,15-17,19-21,23-27,30-42,44-48H,6-8H2/t15-,16-,17-,19-,20-,21-,23+,24+,25+,26-,27-,30+,31-,32+,33+/m1/s1 |
| SMILES |
O=c1c(O[C@@H]2OC(CO)[C@@H](O)C(O)C2O[C@@H]2OC(CO)[C@@H](O)C(O)[C@H]2O)c(-c2ccc(O)c(O)c2)oc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium cepa  | Ref. |
| Plantae | Cruciferae | Brassica napus  | Ref. |
| Plantae | Cruciferae | Brassica oleracea  | Ref. |
| Plantae | Cruciferae | Brassica rapa  | Ref. |
| Plantae | Cruciferae | Sinapis arvensis  | Ref. |
| Plantae | Fabaceae | Lathyrus sylvestris | Ref. |
| Plantae | Ranunculaceae | Ranunculus biternatus | Ref. |
| Plantae | Ranunculaceae | Ranunculus moseleyi | Ref. |
| Plantae | Ranunculaceae | Ranunculus pseudotrullifolius | Ref. |
| Plantae | Solanaceae | Datura innoxia  | Ref. |
| Plantae | Solanaceae | Nicotiana spp. | Ref. |
| Plantae | Solanaceae | Petunia x hybrida | Ref. |
|
|
zoom in
| Organism | Ranunculus moseleyi | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Bikofer,Z.Naturforsch. B.,17,(1962),359
Ranabahu,Biochem.Syst.Ecol.,21,(1993),715 |
|---|
|