| Name |
Cucurbitacin B |
| Formula |
C32H46O8 |
| Mw |
558.31926845 |
| CAS RN |
6199-67-3 |
| C_ID |
C00003683
, 
|
| InChIKey |
IXQKXEUSCPEQRD-UQGYWOQJNA-N |
| InChICode |
InChI=1S/C32H46O8/c1-17(33)40-27(2,3)13-12-23(36)32(9,39)25-21(35)15-29(6)22-11-10-18-19(14-20(34)26(38)28(18,4)5)31(22,8)24(37)16-30(25,29)7/h10,12-13,19-22,25,34-35,39H,11,14-16H2,1-9H3/b13-12+/t19-,20+,21-,22+,25+,29+,30-,31+,32+/m1/s1 |
| SMILES |
CC(=O)OC(C)(C)/C=C/C(=O)[C@](C)(O)[C@H]1[C@H](O)C[C@@]2(C)[C@@H]3CC=C4[C@@H](C[C@H](O)C(=O)C4(C)C)[C@]3(C)C(=O)C[C@]12C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Chrysomelidae | Diabrotica undecimpunctata howardi | Ref. |
| Fungi | Tricholomataceae | Leucopaxillus gentianeus | Ref. |
| Plantae | Begoniaceae | Begonia nantoensis | Ref. |
| Plantae | Chrysobalanaceae | Licania intrapetiolaris | Ref. |
| Plantae | Cruciferae | Iberis spp. | Ref. |
| Plantae | Cucurbitaceae | Bryonia alba  | Ref. |
| Plantae | Cucurbitaceae | Bryonia dioica  | Ref. |
| Plantae | Cucurbitaceae | Citrullus colocynthis  | Ref. |
| Plantae | Cucurbitaceae | Cucumis africanus | Ref. |
| Plantae | Cucurbitaceae | Cucumis melo  | Ref. |
| Plantae | Cucurbitaceae | Cucurbita sp.  | Ref. |
| Plantae | Myrsinaceae | Anagallis arvensis  | Ref. |
| Plantae | Samydaceae | Casearia arborea | Ref. |
|
|
zoom in
| Organism | Citrullus colocynthis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|