| Name |
Tetrahydroberberine (S)-Tetrahydroberberine Canadine Tetrahydroumbellatine Xanthopuccine |
| Formula |
C20H21NO4 |
| Mw |
339.14705817 |
| CAS RN |
522-97-4 |
| C_ID |
C00001827
, 
|
| InChIKey |
VZTUIEROBZXUFA-XISACWJONA-N |
| InChICode |
InChI=1S/C20H21NO4/c1-22-17-4-3-12-7-16-14-9-19-18(24-11-25-19)8-13(14)5-6-21(16)10-15(12)20(17)23-2/h3-4,8-9,16H,5-7,10-11H2,1-2H3/t16-/m0/s1 |
| SMILES |
COc1ccc2c(c1OC)CN1CCc3cc4c(cc3[C@@H]1C2)OCO4 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Rollinia mucosa  | Ref. |
| Plantae | Berberidaceae | Berberis aquifolium | Ref. |
| Plantae | Berberidaceae | Berberis aristata  | Ref. |
| Plantae | Berberidaceae | Berberis thunbergii  | Ref. |
| Plantae | Berberidaceae | Berberis vulgaris  | Ref. |
| Plantae | Berberidaceae | Berberis wilsoniae | Ref. |
| Plantae | Berberidaceae | Mahonia aquifolium | Ref. |
| Plantae | Fumariaceae | Corydalis bungeana  | Ref. |
| Plantae | Fumariaceae | Corydalis cheilantheifolia | Ref. |
| Plantae | Fumariaceae | Corydalis pallida | Ref. |
| Plantae | Fumariaceae | Corydalis yanhusuo  | Ref. |
| Plantae | Lauraceae | Lindera glauca | Ref. |
| Plantae | Papaveraceae | Argemone mexicana  | Ref. |
| Plantae | Papaveraceae | Chelidonium majus  | Ref. |
| Plantae | Papaveraceae | Macleaya cordata  | Ref. |
| Plantae | Ranunculaceae | Coptis japonica  | Ref. |
| Plantae | Ranunculaceae | Thalictrum flavum | Ref. |
| Plantae | Ranunculaceae/Hydrastidaceae | Hydrastis canadensis  | Ref. |
| Plantae | Rutaceae | Fagara rhoifolia | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Rutaceae | Phellodendron chinensis | Ref. |
| Plantae | Rutaceae | Zanthoxylum brachyacanthum | Ref. |
| Plantae | Rutaceae | Zanthoxylum veneficum | Ref. |
| - | - | Mohonia bealei | Ref. |
|
|
zoom in
| Organism | Corydalis bungeana | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|