| Name |
5-Hydroxytryptamine Serotonin DS substance Enteramin Enteramine Thrombocytin Thrombotonin |
| Formula |
C10H12N2O |
| Mw |
176.09496302 |
| CAS RN |
50-67-9 |
| C_ID |
C00001429
, 
|
| InChIKey |
QZAYGJVTTNCVMB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C10H12N2O/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10/h1-2,5-6,12-13H,3-4,11H2 |
| SMILES |
NCCc1c[nH]c2ccc(O)cc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| -- | Bangiaceae | Porphyra umbilicalis  | Ref. |
| -- | Gigartinaceae | Chondrus crispus  | Ref. |
| -- | Gonyaulacaceae | Alexandrium lusitanicum | Ref. |
| -- | Gracilariaceae | Gracilaria tenustipitata | Ref. |
| -- | Palmariaceae | Palmaria palmata  | Ref. |
| -- | Tetrahymenidae | Tetrahymena thermophila | Ref. |
| Animalia | Bombycidae | Bombyx batryticatus | Ref. |
| Animalia | Bufonidae | Bufo bufo gargarizans | Ref. |
| Animalia | Clionaidae | Cliona delitrix | Ref. |
| Animalia | Muridae | Rattus sp. | Ref. |
| Animalia | Scolopendridae | Scolopendra subspinipes | Ref. |
| Bacteria | Rhodospirillaceae | Rhodospirillum rubrum | Ref. |
| Bacteria | Sphingomonadaceae | Erythrobacter longus | Ref. |
| Excavata | Euglenaceae | Euglena gracilis | Ref. |
| Fungi | Saccharomycetaceae | Saccharomyces cerevisiae  | Ref. |
| Fungi | Sordariaceae | Neurospora crassa | Ref. |
| Plantae | -- | Lonicera japonica  | Ref. |
| Plantae | Acanthaceae | Andrographis paniculatus | Ref. |
| Plantae | Apiaceae | Angelica biserrata | Ref. |
| Plantae | Apiaceae | Angelica sinensis  | Ref. |
| Plantae | Araceae | Amorphophallus konjac K.Koch  | Ref. |
| Plantae | Araliaceae | Panax notoginsneg | Ref. |
| Plantae | Asphodelaceae | Aloe vela | Ref. |
| Plantae | Asteraceae | Dendranthema morifolium | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Asteraceae | Tanacetum parthenium  | Ref. |
| Plantae | Berberidaceae | Epimedium brevicornum  | Ref. |
| Plantae | Boraginaceae | Arnebia euchroma  | Ref. |
| Plantae | Bromeliaceae | Ananas comosus  | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Lobelia chinensis  | Ref. |
| Plantae | Caprifoliaceae | Patrinia scabiosifolia | Ref. |
| Plantae | Caryophyllales | Beta vulgaris  | Ref. |
| Plantae | Chenopodiaceae | Chenopodium rubrum | Ref. |
| Plantae | Convallariaceae | Ophiopogon japonicus  | Ref. |
| Plantae | Convallariaceae | Polygonatum sibiricum  | Ref. |
| Plantae | Convolvulaceae | Pharbitis nil  | Ref. |
| Plantae | Cruciferae | Isatis indigotica  | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Cucurbitaceae | Cucumis sativus  | Ref. |
| Plantae | Elaeagnaceae | Hippophae rhamnoides  | Ref. |
| Plantae | Eucommiaceae | Eucommia ulmoides  | Ref. |
| Plantae | Fabaceae | Albizia julibrissin  | Ref. |
| Plantae | Fabaceae | Desmodium styracifolium  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Mimosa zimapanensis | Ref. |
| Plantae | Fabaceae | Mucuna pruriens  | Ref. |
| Plantae | Fabaceae | Phaseolus coccineus  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Pueraria lobata  | Ref. |
| Plantae | Fabaceae | Samanea saman | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Gentianaceae | Gentiana macrophylla  | Ref. |
| Plantae | Gentianaceae | Gentiana scabra  | Ref. |
| Plantae | Hypericaceae | Hypericum perforatum  | Ref. |
| Plantae | Juglandaceae | Juglans regia ssp. Fallax  | Ref. |
| Plantae | Juglandaceae | Juglans sieboldiana  | Ref. |
| Plantae | Labiatae | Leonurus japonicus  | Ref. |
| Plantae | Labiatae | Prunella vulgaris  | Ref. |
| Plantae | Labiatae | Salvia miltiorrhiza  | Ref. |
| Plantae | Labiatae | Scutellaria amoena | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Laminariaceae | Laminaria digitata  | Ref. |
| Plantae | Loranthaceae | Taxillus chinensis  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Gossypium hirsutum  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Musaceae | Musa acuminata  | Ref. |
| Plantae | Musaceae | Musa paradisiaca Linn.  | Ref. |
| Plantae | Musaceae | Musa sapientum  | Ref. |
| Plantae | Musaceae | Musa spp.  | Ref. |
| Plantae | Myrtaceae | Syzygium aromaticum  | Ref. |
| Plantae | Oleaceae | Forsythia suspensa  | Ref. |
| Plantae | Orobanchaceae | Cistanche deseriocola | Ref. |
| Plantae | Polygalaceae | Polygala tenuifolia  | Ref. |
| Plantae | Polygonaceae | Polygonum multiflorum  | Ref. |
| Plantae | Polygonaceae | Rheum palmatum  | Ref. |
| Plantae | Polyphysaceae | Acetabularia acetabulum | Ref. |
| Plantae | Ranunculaceae | Coptis chinensis  | Ref. |
| Plantae | Rhamnaceae | Ziziphus jujuba  | Ref. |
| Plantae | Rosaceae | Prunus cerasus  | Ref. |
| Plantae | Rosaceae | Rubus chingii | Ref. |
| Plantae | Rubiaceae | Uncaria rhynchophylla  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ningpoensis  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Datura metel  | Ref. |
| Plantae | Solanaceae | Lycium barbarum  | Ref. |
| Plantae | Solanaceae | Nicotiana tobacum | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Urticaceae | Urtica dioica  | Ref. |
| Plantae | Violaceae | Viola philipica | Ref. |
| Plantae | Zingiberaceae | Curcuma aeruginosa  | Ref. |
| Protozoa | Gymnodiniaceae | Amphidinium carterae | Ref. |
| Viridiplantae | Dunaliellaceae | Dunaliella teriolecta | Ref. |
| - | - | Agastaches rugosa | Ref. |
| - | - | Artemisis anna | Ref. |
| - | - | Babreum coscluea | Ref. |
| - | - | Ceratium horridum | Ref. |
| - | - | Chlomydomonas spp. | Ref. |
| - | - | Coruns officinalis | Ref. |
| - | - | Didymosphaeria mori-albae | Ref. |
| - | - | Galdenia jasminoides | Ref. |
| - | - | Gekko japanicus | Ref. |
| - | - | Gonyaulax polyedra | Ref. |
| - | - | Hyrtios reticulatus | Ref. |
| - | - | Lingulodinium polyedrum | Ref. |
| - | - | Lophartherum gracile | Ref. |
| - | - | Mahania bealei | Ref. |
| - | - | Noctiluca scintillans | Ref. |
| - | - | Patriniae scabiosaefoliae | Ref. |
| - | - | Periostracum cicadae | Ref. |
| - | - | Petalonia fascia  | Ref. |
| - | - | Pheretima aspergillum | Ref. |
| - | - | Pirola decorata | Ref. |
| - | - | Poria cocos  | Ref. |
| - | - | Pterygophora californica | Ref. |
| - | - | Pyrocystis lunula | Ref. |
| - | - | Saposhmikovia divaricata | Ref. |
| - | - | Schisondra chinensis | Ref. |
| - | - | Trypanosoma cruzi | Ref. |
|
|
zoom in
| Organism | Bufo bufo gargarizans | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|