| Name |
alpha-Amyrin alpha-Amyrine alpha-Amyrenol |
| Formula |
C30H50O |
| Mw |
426.38616622 |
| CAS RN |
638-95-9 |
| C_ID |
C00003737
, 
|
| InChIKey |
SGYDZCYMKXFTKG-ATMISIKVNA-N |
| InChICode |
InChI=1S/C30H50O/c1-19-11-14-27(5)17-18-29(7)21(25(27)20(19)2)9-10-23-28(6)15-13-24(31)26(3,4)22(28)12-16-30(23,29)8/h9-10,19-25,31H,11-18H2,1-8H3/t19-,20+,21-,22-,23-,24+,25-,27-,28+,29-,30-/m1/s1 |
| SMILES |
C[C@H]1[C@H](C)CC[C@]2(C)CC[C@]3(C)C(C=C[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Adhatoda vasica  | Ref. |
| Plantae | Anacardiaceae | Schinus terebinthus | Ref. |
| Plantae | Apiaceae | Angelica archangelica  | Ref. |
| Plantae | Apocynaceae | Alstonia boonei  | Ref. |
| Plantae | Apocynaceae | Calotropis gigantea  | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Apocynaceae | Hemidesmus indicus  | Ref. |
| Plantae | Apocynaceae | Solenostemma argel  | Ref. |
| Plantae | Apocynaceae | Thevetia peruviana  | Ref. |
| Plantae | Aquifoliaceae | Ilex asprella | Ref. |
| Plantae | Aquifoliaceae | Ilex pubescens  | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asteraceae | Achillea alexandri-regis Bornm.& Rudski | Ref. |
| Plantae | Asteraceae | Ajania fruticulosa  | Ref. |
| Plantae | Asteraceae | Artemisia vulgaris  | Ref. |
| Plantae | Asteraceae | Centaurea cineraria L. | Ref. |
| Plantae | Asteraceae | Eupatorium macrocephalum Lee.  | Ref. |
| Plantae | Asteraceae | Inula cappa  | Ref. |
| Plantae | Asteraceae | Senecio chionophilus | Ref. |
| Plantae | Asteraceae | Senecio viravira | Ref. |
| Plantae | Asteraceae | Sonchus arvensis  | Ref. |
| Plantae | Balanophoraceae | Balanophora elongata | Ref. |
| Plantae | Boraginaceae | Ehretia buxifolia  | Ref. |
| Plantae | Buddlejaceae | Buddleja madagascariensis | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Celastraceae | Tripterygium wilfordii  | Ref. |
| Plantae | Combretaceae | Terminalia brasiliensis | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica oleracea  | Ref. |
| Plantae | Cruciferae | Brassica rapa  | Ref. |
| Plantae | Ebenaceae | Diospyros cordifolia  | Ref. |
| Plantae | Ebenaceae | Diospyros cornii | Ref. |
| Plantae | Ebenaceae | Diospyros ebenum  | Ref. |
| Plantae | Ebenaceae | Diospyros kaki  | Ref. |
| Plantae | Ebenaceae | Diospyros kirkii | Ref. |
| Plantae | Ebenaceae | Diospyros mafiensis | Ref. |
| Plantae | Ebenaceae | Diospyros maingayi | Ref. |
| Plantae | Ebenaceae | Diospyros melanoxylon  | Ref. |
| Plantae | Ebenaceae | Diospyros mespiliformis  | Ref. |
| Plantae | Ebenaceae | Diospyros montana  | Ref. |
| Plantae | Ebenaceae | Diospyros natalensis | Ref. |
| Plantae | Ebenaceae | Diospyros sylvatica | Ref. |
| Plantae | Ericaceae | Enkianthus cernuus | Ref. |
| Plantae | Ericaceae | Epigaea asiatica | Ref. |
| Plantae | Ericaceae | Leucothoe grayana Max. | Ref. |
| Plantae | Ericaceae | Pieris japonica D.Don.  | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum coca  | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum rimosum | Ref. |
| Plantae | Euphorbiaceae | Croton zambesicus  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia hirta  | Ref. |
| Plantae | Fabaceae | Albizia lebbeck  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Gentianaceae | Gentiana lutea  | Ref. |
| Plantae | Gentianaceae | Gentiana scabra  | Ref. |
| Plantae | Gentianaceae | Gentiana straminea  | Ref. |
| Plantae | Icacinaceae | Gonocaryum calleryanum  | Ref. |
| Plantae | Iridaceae | Iris germanica L.  | Ref. |
| Plantae | Labiatae | Lavandula canariensis | Ref. |
| Plantae | Labiatae | Marsypianthes chamaedrys  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Salvia amplexicaulis Lam. | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Sideritis argosphacelus var. spicata | Ref. |
| Plantae | Labiatae | Sideritis candicans var.eriocephala | Ref. |
| Plantae | Labiatae | Sideritis discolor | Ref. |
| Plantae | Labiatae | Sideritis kuegleriana | Ref. |
| Plantae | Labiatae | Sideritis lotsyi var. mascaensis | Ref. |
| Plantae | Labiatae | Sideritis tenoi | Ref. |
| Plantae | Linaceae | Linum scabrellum | Ref. |
| Plantae | Longaniaceae | Strychnos potatorum  | Ref. |
| Plantae | Malvaceae | Eriolaena hookeriana | Ref. |
| Plantae | Malvaceae | Malva parviflora  | Ref. |
| Plantae | Moraceae | Ficus variegata  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrina  | Ref. |
| Plantae | Moringaceae | Moringa peregrine | Ref. |
| Plantae | Moringaceae | Moringa stenopetala  | Ref. |
| Plantae | Myrsinaceae | Ardisia solanacea  | Ref. |
| Plantae | Oleaceae | Olea europaea  | Ref. |
| Plantae | Plumbaginaceae | Plumbago zeylanica  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rubiaceae | Chiococca alba  | Ref. |
| Plantae | Rubiaceae | Psychotria adenophylla  | Ref. |
| Plantae | Rutaceae | Dictamnus hispanicus  | Ref. |
| Plantae | Rutaceae | Vepris punctata | Ref. |
| Plantae | Rutaceae | Zanthoxylum armatum  | Ref. |
| Plantae | Salicaceae | Populus tremula L.  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Verbenaceae | Duranta plumieri  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Crotone hieronymi | Ref. |
| - | - | Decalepsis hamiltonii | Ref. |
| - | - | Moghania macrophylla | Ref. |
| - | - | Protium heptaphylum | Ref. |
| - | - | Tevenotica persica | Ref. |
|
|
zoom in
| Organism | Linum scabrellum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|