| Name |
Syringic acid Syringate 4-Hydroxy-3,5-dimethoxybenzoic acid |
| Formula |
C9H10O5 |
| Mw |
198.05282343 |
| CAS RN |
530-57-4 |
| C_ID |
C00002674
, 
|
| InChIKey |
JMSVCTWVEWCHDZ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C9H10O5/c1-13-6-3-5(9(11)12)4-7(14-2)8(6)10/h3-4,10H,1-2H3,(H,11,12) |
| SMILES |
COc1cc(C(=O)O)cc(OC)c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Fungi | Hymenochaetaceae | Inonotus obliquus  | Ref. |
| Fungi | Hymenochaetaceae | Phellinus igniarius  | Ref. |
| Plantae | Acanthaceae | Strobilanthes crispus  | Ref. |
| Plantae | Alliaceae | Allium sativum  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Falcaria vulgaris | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Aristolochiaceae | Aristolochia heterophylla Hemsl  | Ref. |
| Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
| Plantae | Asteraceae | Calendula officinalis  | Ref. |
| Plantae | Asteraceae | Chamomilla rectita | Ref. |
| Plantae | Asteraceae | Cichorium intybus  | Ref. |
| Plantae | Asteraceae | Conyza canadensis  | Ref. |
| Plantae | Asteraceae | Conyza candensis | Ref. |
| Plantae | Asteraceae | Inula britannica  | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Asteraceae | Taraxacum formosanum | Ref. |
| Plantae | Balsaminaceae | Impatiens balsamina  | Ref. |
| Plantae | Bignoniaceae | Catalpa ovata  | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Celastraceae | Microtropis fokienensis | Ref. |
| Plantae | Clusiaceae-Guttiferae | Caraipa densifolia  | Ref. |
| Plantae | Commelinaceae | Commelina communis  | Ref. |
| Plantae | Convallariaceae | Tupistra chinensis | Ref. |
| Plantae | Crassulaceae | Bryophyllum pinnatum  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Isatis indigotica  | Ref. |
| Plantae | Cruciferae | Isatis tinctoria  | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Cucurbitaceae | Momordica charantia  | Ref. |
| Plantae | Ebenaceae | Diospyros eriantha | Ref. |
| Plantae | Ericaceae | Rhododendron dauricum  | Ref. |
| Plantae | Ericaceae | Rhododendron micranthum | Ref. |
| Plantae | Ericaceae | Rhododendron mucronatum | Ref. |
| Plantae | Ericaceae | Rhododendron mucronulatum  | Ref. |
| Plantae | Euphorbiaceae | Cleidion spiciflorum (Burm. f.) Merr.  | Ref. |
| Plantae | Fabaceae | Derris scandens  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Fagaceae | Quercus infectoria  | Ref. |
| Plantae | Hypoxidaceae | Curculigo orchioides  | Ref. |
| Plantae | Iridaceae | Crocus sativus  | Ref. |
| Plantae | Labiatae | Callicarpa integerrima | Ref. |
| Plantae | Labiatae | Hyssopus officinalis  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Satureja hortensis  | Ref. |
| Plantae | Labiatae | Satureja subspicata  | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
| Plantae | Lauraceae | Cinnamomum subavenium MIQ. | Ref. |
| Plantae | Lythraceae | Punica granatum L.  | Ref. |
| Plantae | Malvaceae | Abutilon indicum  | Ref. |
| Plantae | Malvaceae | Althaea nudiflora | Ref. |
| Plantae | Malvaceae | Althaea officinalis  | Ref. |
| Plantae | Malvaceae | Althaea rosea  | Ref. |
| Plantae | Malvaceae | Hibiscus taiwanensis | Ref. |
| Plantae | Malvaceae | Hibiscus tiliaceus  | Ref. |
| Plantae | Meliaceae | Trichilia emetica  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrina  | Ref. |
| Plantae | Moringaceae | Moringa peregrine | Ref. |
| Plantae | Moringaceae | Moringa stenopetala  | Ref. |
| Plantae | Myrtaceae | Syzygium aromaticum  | Ref. |
| Plantae | Palmae | Cocos nucifera  | Ref. |
| Plantae | Palmae | Phoenix dactylifera  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Piperaceae | Peperomia duclouxii C. DC. | Ref. |
| Plantae | Plantaginaceae | Plantago lanceolata  | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Plantaginaceae | Plantago media  | Ref. |
| Plantae | Plantaginaceae | Veronica spicata | Ref. |
| Plantae | Plumbaginaceae | Ceratostigma willmottianum | Ref. |
| Plantae | Poaceae | Avena sativa  | Ref. |
| Plantae | Poaceae | Eleusine coracana  | Ref. |
| Plantae | Poaceae | Hordeum vulgare  | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Poaceae | Panicum milliaceum | Ref. |
| Plantae | Poaceae | Secale cereale  | Ref. |
| Plantae | Poaceae | Sorghum bicolor  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Poaceae | Zea mays  | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica  | Ref. |
| Plantae | Rhamnaceae | Ceanothus americanus  | Ref. |
| Plantae | Rhamnaceae | Colubrina faralaotra subsp.trichocarpa. | Ref. |
| Plantae | Rosaceae | Mespilus germanica  | Ref. |
| Plantae | Rosaceae | Spiraea formosana  | Ref. |
| Plantae | Rubiaceae | Rubia yunnanensis | Ref. |
| Plantae | Rutaceae | Citrus spp. | Ref. |
| Plantae | Rutaceae | Melicope semecarpifolia | Ref. |
| Plantae | Rutaceae | Zanthoxylum simulans | Ref. |
| Plantae | Santalaceae | Santalum album  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia frutescens | Ref. |
| Plantae | Smilacaceae | Smilax glabra  | Ref. |
| Plantae | Solanaceae | Withania somnifera  | Ref. |
| Plantae | Tamaricaceae | Tamarix gallica  | Ref. |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
| Plantae | Zingiberaceae | Aframomum giganteum | Ref. |
| - | - | Anisophyllea dichostyla | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | Lentinula edodes  | Ref. |
| - | - | Scrophularis sambucifolia | Ref. |
| - | - | Stenoloma chusanum  | Ref. |
|
|
zoom in
| Organism | Moringa stenopetala | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|