| Name |
L-(+)-Rhamnose L-Rhamnose |
| Formula |
C6H12O5 |
| Mw |
164.06847349 |
| CAS RN |
3615-41-6 |
| C_ID |
C00061608
|
| InChIKey |
PNNNRSAQSRJVSB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C6H12O5/c1-3(8)5(10)6(11)4(9)2-7/h2-6,8-11H,1H3/t3-,4+,5-,6-/m1/s1;InChI=1S/C6H12O5/c1-3(8)5(10)6(11)4(9)2-7/h2-6,8-11H,1H3/t3-,4-,5-,6-/m0/s1;InChI=1S/C6H12O5/c1-3(8)5(10)6(11)4(9)2-7/h2-6,8-11H,1H3 |
| SMILES |
CC(O)C(O)C(O)C(O)C=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Rutaceae | Aegle marmelos  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
|
|
zoom in
| Organism | Aegle marmelos | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|