| Name |
(-)-Epiglobulol Epiglobulol |
| Formula |
C15H26O |
| Mw |
222.19836545 |
| CAS RN |
88728-58-9 |
| C_ID |
C00055838
|
| InChIKey |
AYXPYQRXGNDJFU-RWXDJMAFSA-N |
| InChICode |
InChI=1S/C15H26O/c1-9-5-6-10-12(9)13-11(14(13,2)3)7-8-15(10,4)16/h9-13,16H,5-8H2,1-4H3/t9-,10-,11-,12-,13-,15+/m1/s1 |
| SMILES |
C[C@@H]1CC[C@@H]2[C@@H]1[C@H]1[C@@H](CC[C@]2(C)O)C1(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Rhynchosia minima  | Ref. |
| Plantae | Rutaceae | Atalantia guillauminii | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| Plantae | Zingiberaceae | Curcuma kwangsiensis  | Ref. |
| Plantae | Zingiberaceae | Curcuma phaeocaulis  | Ref. |
| Plantae | Zingiberaceae | Curcuma wenyujin  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
|
|
zoom in
| Organism | Zingiber officinale | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|