| Name |
gamma-Cadinene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
39029-41-9 |
| C_ID |
C00030345
, 
|
| InChIKey |
WRHGORWNJGOVQY-JCUKGLBFNA-N |
| InChICode |
InChI=1S/C15H24/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h9-10,13-15H,4-8H2,1-3H3/t13-,14-,15+/m1/s1 |
| SMILES |
C=C1CC[C@H](C(C)C)[C@H]2C=C(C)CC[C@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Strobilanthes ixiocephala | Ref. |
| Plantae | Annonaceae | Guatteriopsis blepharophylla | Ref. |
| Plantae | Annonaceae | Monodora myristica  | Ref. |
| Plantae | Annonaceae | Xylopia frutescens  | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apocynaceae | Tabernaemontana catharinensis | Ref. |
| Plantae | Asteraceae | Ageratina conyzoides | Ref. |
| Plantae | Asteraceae | Ambrosia trifida | Ref. |
| Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Centaurea atropurpurea | Ref. |
| Plantae | Asteraceae | Centaurea orientalis | Ref. |
| Plantae | Asteraceae | Cyathocline purpurea | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Asteraceae | Petasites albus  | Ref. |
| Plantae | Asteraceae | Petasites hybridus  | Ref. |
| Plantae | Asteraceae | Phagnalon sordidum | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Cistaceae | Cistus albidus | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Fagaceae | Quercus coccifera  | Ref. |
| Plantae | Geraniaceae | Pelargonium graveolens  | Ref. |
| Plantae | Jubulaceae | Frullania anomala | Ref. |
| Plantae | Jubulaceae | Frullania aterrima var. lepida | Ref. |
| Plantae | Jubulaceae | Frullania incumbens | Ref. |
| Plantae | Jubulaceae | Frullania ptychantha | Ref. |
| Plantae | Labiatae | Clinopodium nepeta | Ref. |
| Plantae | Labiatae | Lavandula angustifolia  | Ref. |
| Plantae | Labiatae | Lavandula dentata  | Ref. |
| Plantae | Labiatae | Lavandula multifida  | Ref. |
| Plantae | Labiatae | Lavandula stoechas  | Ref. |
| Plantae | Labiatae | Mentha arvensis L.  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Satureja subspicata  | Ref. |
| Plantae | Labiatae | Thymus broussonetti | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Labiatae | Thymus maroccanus | Ref. |
| Plantae | Labiatae | Thymus praecos | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
| Plantae | Lauraceae | Cinnamomum illicioides | Ref. |
| Plantae | Meliaceae | Guarea macrophylla ssp.tuberculata | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| Plantae | Myrtaceae | Leptospermum scoparium  | Ref. |
| Plantae | Myrtaceae | Melaleuca leucadendra L.  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Pinaceae | Cedrus libani  | Ref. |
| Plantae | Pinaceae | Pinus halepensis  | Ref. |
| Plantae | Pinaceae | Pinus mugo subsp. Mugo  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Piperaceae | Piper fimbriulatum | Ref. |
| Plantae | Piperaceae | Piper obliquum  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Murraya exotica  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Taxodiaceae | Cryptomeria japonica D.Don | Ref. |
| Plantae | Taxodiaceae | Taiwania cryptomerioides | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| Plantae | Zingiberaceae | Curcuma amada  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Lavandin abrialis | Ref. |
|
|
zoom in
| Organism | Tabernaemontana catharinensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|