| Name |
Clionasterol gamma-Sitosterol |
| Formula |
C29H50O |
| Mw |
414.38616622 |
| CAS RN |
83-47-6 |
| C_ID |
C00023769
, 
|
| InChIKey |
KZJWDPNRJALLNS-XNMQMIFBNA-N |
| InChICode |
InChI=1S/C29H50O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h10,19-21,23-27,30H,7-9,11-18H2,1-6H3/t20-,21+,23+,24+,25-,26+,27+,28+,29-/m1/s1 |
| SMILES |
CC[C@@H](CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C)C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Amoebozoa | Physaridae | Physarum flavicomum | Ref. |
| Amoebozoa | Physaridae | Physarum polycephalum | Ref. |
| Chromalveolata | Heterosigmataceae | Heterosigma akashiwo | Ref. |
| Plantae | Acoraceae | Acorus calanus L. | Ref. |
| Plantae | Apiaceae | Peucedanum rubricaule | Ref. |
| Plantae | Asteraceae | Gynura segetum | Ref. |
| Plantae | Cruciferae | Isatis indigotica  | Ref. |
| Plantae | Malvaceae | Abutilon indicum  | Ref. |
| Plantae | Polygonaceae | Polygonum bistorta  | Ref. |
| Plantae | Rutaceae | Aegle marmelos  | Ref. |
| Plantae | Rutaceae | Citrus limonia  | Ref. |
| Plantae | Verbenaceae | Clerodendron cyrtophyllum | Ref. |
| - | - | Chloromorum toxicum | Ref. |
|
|
zoom in
| Organism | Isatis indigotica | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Rao, et al., APS, 26, (1991), 30.
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|