| Name |
3-Methoxy-p-cymene Thymyl methyl ether 1-Isopropyl-2-methoxy-4-methylbenzene 2-Isopropyl-5-methylanisole Thymol methyl ether Methyl thymyl ether |
| Formula |
C11H16O |
| Mw |
164.12011513 |
| CAS RN |
1076-56-8 |
| C_ID |
C00010866
, 
|
| InChIKey |
LSQXNMXDFRRDSJ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C11H16O/c1-8(2)10-6-5-9(3)7-11(10)12-4/h5-8H,1-4H3 |
| SMILES |
COc1cc(C)ccc1C(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Cyprinidae | Orthodon hadai | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Xylopia sericea  | Ref. |
| Plantae | Apiaceae | Crithmum maritimum  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Aristolochiaceae | Asarum sieboldii  | Ref. |
| Plantae | Asteraceae | Ambrosia trifida | Ref. |
| Plantae | Asteraceae | Arnica montana  | Ref. |
| Plantae | Asteraceae | Cyathocline purpurea | Ref. |
| Plantae | Asteraceae | Eupatorium fortunei  | Ref. |
| Plantae | Asteraceae | Petasites albus  | Ref. |
| Plantae | Asteraceae | Petasites hybridus  | Ref. |
| Plantae | Asteraceae | Petasites japonicus  | Ref. |
| Plantae | Asteraceae | Pulicaria dysenterica  | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Pinaceae | Pinus mugo subsp. Mugo  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus spp. | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Schisandraceae | Schisandra chinensis  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
|
|
zoom in
| Organism | Asarum sieboldii | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Liang, et al., Acta Pharmaceutica Sinica(Yaoxue Xuebao), 7, (1959), 131.
Cai, et al., Zhongyao Tongbao, 8, (1983), 30.
Naya, et al., Tetrahedron Lett, (1971), 2961 |
|---|
|