| Name |
7-O-Methylaromadendrin Methylaromadendrin Aromadendrin 7-methyl ether |
| Formula |
C16H14O6 |
| Mw |
302.07903818 |
| CAS RN |
37971-69-0 |
| C_ID |
C00008556
, 
|
| InChIKey |
LZLGHWHSUZVUFZ-REIYMHPCNA-N |
| InChICode |
InChI=1S/C16H14O6/c1-21-10-6-11(18)13-12(7-10)22-16(15(20)14(13)19)8-2-4-9(17)5-3-8/h2-7,15-18,20H,1H3/t15-,16-/m0/s1 |
| SMILES |
COc1cc(O)c2c(c1)O[C@H](c1ccc(O)cc1)[C@@H](O)C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia scoparia  | Ref. |
| Plantae | Asteraceae | Artemisia spp.  | Ref. |
| Plantae | Asteraceae | Dittrichia viscosa  | Ref. |
| Plantae | Asteraceae | Inula graveolens | Ref. |
| Plantae | Asteraceae | Pulicaria undulata  | Ref. |
| Plantae | Myrtaceae | Eucalyptus spp.  | Ref. |
| Plantae | Podocarpaceae | Podocarpus nivalis | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Salicaceae | Populus alba  | Ref. |
|
|
zoom in
| Organism | Podocarpus nivalis | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 674,Flavanones and dihydroflavonols
Gell,Aust.J.Chem.,11,(1958),372
Hetz,Phytochem.,11,(1972),2859 |
|---|
|