| Name |
Pelargonidin 3-rutinoside |
| Formula |
C27H31O14 |
| Mw |
579.1713807 |
| CAS RN |
33978-17-5 |
| C_ID |
C00006639
, 
|
| InChIKey |
IFYOHQQBIKDHFT-UFZXBIHZNA-O |
| InChICode |
InChI=1S/C27H30O14/c1-10-19(31)21(33)23(35)26(38-10)37-9-18-20(32)22(34)24(36)27(41-18)40-17-8-14-15(30)6-13(29)7-16(14)39-25(17)11-2-4-12(28)5-3-11/h2-8,10,18-24,26-27,31-36H,9H2,1H3,(H2-,28,29,30)/p+1/t10-,18+,19-,20+,21-,22-,23+,24+,26+,27+/m0/s1 |
| SMILES |
CC1O[C@@H](OCC2O[C@@H](Oc3cc4c(O)cc(O)cc4[o+]c3-c3ccc(O)cc3)C(O)C(O)[C@@H]2O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alstroemeriaceae | Alstroemeria spp. | Ref. |
| Plantae | Amaryllidaceae | Clivia nobilis | Ref. |
| Plantae | Araceae | Anthurium spp. | Ref. |
| Plantae | Araceae | Dracontium spp. | Ref. |
| Plantae | Araceae | Xanthosoma spp. | Ref. |
| Plantae | Bignoniaceae | Spathodea campanulata  | Ref. |
| Plantae | Bromeliaceae | Pitcairnia spp. | Ref. |
| Plantae | Caryophyllaceae | Silene dioica | Ref. |
| Plantae | Euphorbiaceae | Euphorbia heterophylla  | Ref. |
| Plantae | Euphorbiaceae | Poinsettia spp. | Ref. |
| Plantae | Fabaceae | Delonix regia  | Ref. |
| Plantae | Gesneriaceae | Episcia spp. | Ref. |
| Plantae | Gesneriaceae | Kohleria bogotensis | Ref. |
| Plantae | Gesneriaceae | Rhabdothamnus solandri  | Ref. |
| Plantae | Liliaceae | Tulipa spp. | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Musaceae | Musa x paradisiaca | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Prunus sargentii | Ref. |
| Plantae | Rosaceae | Rubus spp.  | Ref. |
| Plantae | Rubiaceae | Damnacanthus macrophyllus | Ref. |
| Plantae | Rubiaceae | Lasianthus japonicus | Ref. |
| Plantae | Rubiaceae | Mitchella undulata | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Petunia exserta | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| - | - | Slanum betacea | Ref. |
|
|
zoom in
| Organism | Pitcairnia spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Lowry,Malaysian J.Sci.,1,(1972),133
Barritt,J.Chromatogr.,75,(1973),151 |
|---|
|