| Name |
Isorhamnetin-3-O-rhamnoside Isorhamnetin 3-rhamnoside 3-[(6-Deoxy-alpha-L-mannopyranosyl)oxy]-5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-1-benzopyran-4-one |
| Formula |
C22H22O11 |
| Mw |
462.11621155 |
| CAS RN |
67068-82-0 |
| C_ID |
C00005526
, 
|
| InChIKey |
UXXAEVMOIUAYQT-BIYNICMMNA-N |
| InChICode |
InChI=1S/C22H22O11/c1-8-16(26)18(28)19(29)22(31-8)33-21-17(27)15-12(25)6-10(23)7-14(15)32-20(21)9-3-4-11(24)13(5-9)30-2/h3-8,16,18-19,22-26,28-29H,1-2H3/t8-,16-,18+,19-,22-/m0/s1 |
| SMILES |
COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2O[C@@H]2OC(C)[C@H](O)C(O)[C@@H]2O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Crassulaceae | Sedum album  | Ref. |
| Plantae | Fabaceae | Oxytropis lanata | Ref. |
| Plantae | Iridaceae | Patersonia sericea | Ref. |
| Plantae | Pinaceae | Abies amabilis | Ref. |
| Plantae | Pinaceae | Pinus roxburghii  | Ref. |
| Plantae | Rosaceae | Prunus mume  | Ref. |
| Plantae | Rosaceae | Pyrus bourgaeana  | Ref. |
| Plantae | Velloziaceae | Barbacenia conicostigma | Ref. |
|
|
zoom in
| Organism | Pyrus bourgaeana | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Parker,Phytochem.,18,(1979),508
Williams,Phytochem.,28,(1989),1891 |
|---|
|