| Name |
Wighteone Erythrinin B 5,7,4'-Trihydroxy-6-prenylisoflavone |
| Formula |
C20H18O5 |
| Mw |
338.11542369 |
| CAS RN |
51225-30-0 |
| C_ID |
C00002586
, 
|
| InChIKey |
KIMDVVKVNNSHGZ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H18O5/c1-11(2)3-8-14-16(22)9-17-18(19(14)23)20(24)15(10-25-17)12-4-6-13(21)7-5-12/h3-7,9-10,21-23H,8H2,1-2H3 |
| SMILES |
CC(C)=CCc1c(O)cc2occ(-c3ccc(O)cc3)c(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Argyrocytisus battandieri | Ref. |
| Plantae | Fabaceae | Erythrina indica  | Ref. |
| Plantae | Fabaceae | Erythrina lysistemon  | Ref. |
| Plantae | Fabaceae | Erythrina orientalis | Ref. |
| Plantae | Fabaceae | Erythrina poeppigiana  | Ref. |
| Plantae | Fabaceae | Erythrina suberosa var. glabrescences  | Ref. |
| Plantae | Fabaceae | Erythrina variegata  | Ref. |
| Plantae | Fabaceae | Flemingia philippinensis | Ref. |
| Plantae | Fabaceae | Genista ephedroides | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Laburnum anagyroides  | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Lupinus angustifolius  | Ref. |
| Plantae | Fabaceae | Lupinus polyphyllus | Ref. |
| Plantae | Fabaceae | Neonotonia wightii | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Moraceae | Cudrania cochinchinensis var. gerontogea  | Ref. |
| Plantae | Moraceae | Maclura pomifera | Ref. |
|
|
zoom in
| Organism | Erythrina variegata | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Deshpande,Indian J.Chem.Sect.B.,15,(1977),205
Harborne,Phytochem.,15,(1976),1485 |
|---|
|