| Name |
Pseudotropine |
| Formula |
C8H15NO |
| Mw |
141.11536411 |
| CAS RN |
135-97-7 |
| C_ID |
C00002301
, 
|
| InChIKey |
CYHOMWAPJJPNMW-INTDOSGANA-N |
| InChICode |
InChI=1S/C8H15NO/c1-9-6-2-3-7(9)5-8(10)4-6/h6-8,10H,2-5H2,1H3/t6-,7+,8+ |
| SMILES |
CN1C2CC[C@@H]1C[C@H](O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Convolvulaceae | Argyreia mollis | Ref. |
| Plantae | Solanaceae | Atropa baetica | Ref. |
| Plantae | Solanaceae | Atropa belladonna  | Ref. |
| Plantae | Solanaceae | Brugmansia arborea  | Ref. |
| Plantae | Solanaceae | Cyphomandra betaceae | Ref. |
| Plantae | Solanaceae | Datura ceratocaula  | Ref. |
| Plantae | Solanaceae | Datura innoxia  | Ref. |
| Plantae | Solanaceae | Datura metel  | Ref. |
| Plantae | Solanaceae | Datura stramonium x D.discolor  | Ref. |
| Plantae | Solanaceae | Hyoscyamus niger  | Ref. |
| Plantae | Solanaceae | Scopolia carniolica  | Ref. |
| Plantae | Solanaceae | Solanum tubersoum | Ref. |
| Plantae | Solanaceae | Withania somnifera  | Ref. |
| - | - | Mandrogora offinarum | Ref. |
| - | - | Salpichora origanifolia | Ref. |
|
|
zoom in
| Organism | Datura innoxia | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|