| Name |
Bergaptol 5-Hydroxypsoralen |
| Formula |
C11H6O4 |
| Mw |
202.02660868 |
| CAS RN |
486-60-2 |
| C_ID |
C00000581
, 
|
| InChIKey |
GIJHDGJRTUSBJR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C11H6O4/c12-10-2-1-6-9(15-10)5-8-7(11(6)13)3-4-14-8/h1-5,13H |
| SMILES |
O=c1ccc2c(O)c3ccoc3cc2o1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Petroselinum crispum  | Ref. |
| Plantae | Rutaceae | Citrus bergamia  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus maxima  | Ref. |
| Plantae | Rutaceae | Citrus paradisi  | Ref. |
| Plantae | Rutaceae | Citrus spp. | Ref. |
| - | - | citrus spp. | Ref. |
|
|
zoom in
| Organism | citrus spp. | | Reference | Aldrich Library of 13C and 1H FT NMR Spectra,2,(1992),1321A |
|---|
|