| Name |
(+)-Limonene (+)-(R)-limonene D-Limonene (+)-S-Carvone d-(+)-Limonene |
| Formula |
C10H16 |
| Mw |
136.12520051 |
| CAS RN |
5989-27-5 |
| C_ID |
C00010868
, 
|
| InChIKey |
XMGQYMWWDOXHJM-UEQNJFAPNA-N |
| InChICode |
InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,10H,1,5-7H2,2-3H3/t10-/m0/s1 |
| SMILES |
C=C(C)[C@H]1CC=C(C)CC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Anethum graveolens  | Ref. |
| Plantae | Apiaceae | Anethum spp. | Ref. |
| Plantae | Apiaceae | Bupleurum chinense | Ref. |
| Plantae | Apiaceae | Carum carvi L.  | Ref. |
| Plantae | Apiaceae | Coriandrum sativum  | Ref. |
| Plantae | Apiaceae | Cryptotaenia japonica | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apiaceae | Notopterygium forbesii  | Ref. |
| Plantae | Apiaceae | Notopterygium incisum  | Ref. |
| Plantae | Aristolochiaceae | Asarum heterotropoides var.mandshuricum | Ref. |
| Plantae | Aristolochiaceae | Asarum sieboldii  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Artemisia capillaris  | Ref. |
| Plantae | Asteraceae | Echinops grijsii | Ref. |
| Plantae | Burseraceae | Boswellia carterii | Ref. |
| Plantae | Burseraceae | Commiphora mukul  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Ericaceae | Rhododendron anthopogonoides | Ref. |
| Plantae | Fabaceae | Colophospermum mopane  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Geraniaceae | Pelargonium graveolens  | Ref. |
| Plantae | Hamamelidaceae | Liquidambar formosana  | Ref. |
| Plantae | Labiatae | Agastache rugosus | Ref. |
| Plantae | Labiatae | Clinopodium nepeta | Ref. |
| Plantae | Labiatae | Mentha haplocalyx  | Ref. |
| Plantae | Labiatae | Mentha piperita  | Ref. |
| Plantae | Labiatae | Mosla dianthera  | Ref. |
| Plantae | Labiatae | Ocimum americanum  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Ocimum gratissimum  | Ref. |
| Plantae | Labiatae | Ocimum kilimandscharicim | Ref. |
| Plantae | Labiatae | Ocimum sanctum  | Ref. |
| Plantae | Labiatae | Ocimum tenuiflorum  | Ref. |
| Plantae | Labiatae | Perilla frutescens var.acuta  | Ref. |
| Plantae | Labiatae | Perilla frutescens var.crispa  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Schizonepeta tenuifolia  | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
| Plantae | Lamiaceae | Rabdosia rubescens  | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
| Plantae | Myrtaceae | Eucalyptus staigeriana | Ref. |
| Plantae | Oleaceae | Forsythia suspensa  | Ref. |
| Plantae | Pandanaceae | Pandanus tectorius  | Ref. |
| Plantae | Pinaceae | Abies alba  | Ref. |
| Plantae | Pinaceae | Pinus banksiana  | Ref. |
| Plantae | Pinaceae | Pinus bungeana  | Ref. |
| Plantae | Pinaceae | Pinus contorta var. latifolia  | Ref. |
| Plantae | Pinaceae | Pinus koraiensis  | Ref. |
| Plantae | Pinaceae | Pinus taeda | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Rutaceae | Atalantia guillauminii | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus medica  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Evodia rutaecarpa  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Saururaceae | Houttuynia emeiensis | Ref. |
| Plantae | Schisandraceae | Schisandra chinensis  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana jatamansii  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis var.latifolia  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Baeckea frutescens  | Ref. |
| - | - | Pelargonicum graveolens | Ref. |
|
|
zoom in
| Organism | Evodia rutaecarpa | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Xie, et al., Chapter 28, JIU LI XIANG, in Modern Stydies of Chinese Herbal Medicine, edited. By Institute of Materia Medica, Chinese Academy of Medical Sciences, Vol.2, 333-61, Union Press of Beijing Medical University and Peking Union Medical College, Geijing, (1996).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Lu, et al., Chinese Traditional and Herbal Drugs(Zhongcaoyao), 33, (2002), 563.
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003) |
|---|
|