| Name |
Acetylursolic acid Ursolic acid Ursolic acid acetate |
| Formula |
C32H50O4 |
| Mw |
498.37091008 |
| CAS RN |
7372-30-7 |
| C_ID |
C00029633
, 
|
| InChIKey |
PHFUCJXOLZAQNH-GTFLZTGMNA-N |
| InChICode |
InChI=1S/C32H50O4/c1-19-11-16-32(27(34)35)18-17-30(7)22(26(32)20(19)2)9-10-24-29(6)14-13-25(36-21(3)33)28(4,5)23(29)12-15-31(24,30)8/h9,19-20,23-26H,10-18H2,1-8H3,(H,34,35)/t19-,20+,23+,24-,25+,26+,29+,30-,31-,32+/m1/s1 |
| SMILES |
CC(=O)O[C@H]1CC[C@]2(C)[C@H]3CC=C4[C@@H]5[C@@H](C)[C@H](C)CC[C@]5(C(=O)O)CC[C@@]4(C)[C@]3(C)CC[C@H]2C1(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Adoxaceae | Viburnum lantana L.  | Ref. |
| Plantae | Amaranthaceae | Achyranthes aspera  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Heracleum granatense | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Apocynaceae | Nerium oleander  | Ref. |
| Plantae | Apocynaceae | Plumeria obtusa  | Ref. |
| Plantae | Aquifoliaceae | Ilex asprella | Ref. |
| Plantae | Aquifoliaceae | Ilex cornuta  | Ref. |
| Plantae | Aquifoliaceae | Ilex integra | Ref. |
| Plantae | Aquifoliaceae | Ilex pubescens  | Ref. |
| Plantae | Araliaceae | Acanthopanax senticosus  | Ref. |
| Plantae | Araliaceae | Acanthopanax sessiliflorus | Ref. |
| Plantae | Araliaceae | Centella asiatica  | Ref. |
| Plantae | Araliaceae | Cussonia bancoensis | Ref. |
| Plantae | Asteraceae | Achyrocline bogotensis (HBK.) DC. | Ref. |
| Plantae | Asteraceae | Ligularia sagitta | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum polyanthum | Ref. |
| Plantae | Cecropiaceae | Myrianthus arboreus  | Ref. |
| Plantae | Celastraceae | Microtropis japonica | Ref. |
| Plantae | Combretaceae | Terminalia fagifolia | Ref. |
| Plantae | Convallariaceae | Liriope muscari  | Ref. |
| Plantae | Cornaceae | Camptotheca acuminata | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus kousa | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Cruciferae | Isatis tinctoria  | Ref. |
| Plantae | Cynomoriaceae | Cynomorium songaricum | Ref. |
| Plantae | Dipterocarpaceae | Vatica cinerea | Ref. |
| Plantae | Ebenaceae | Diospyros castanea | Ref. |
| Plantae | Ebenaceae | Diospyros cauliflora | Ref. |
| Plantae | Ebenaceae | Diospyros curranii | Ref. |
| Plantae | Ebenaceae | Diospyros ebenum  | Ref. |
| Plantae | Ebenaceae | Diospyros evena | Ref. |
| Plantae | Ebenaceae | Diospyros ferrea | Ref. |
| Plantae | Ebenaceae | Diospyros hirsuta | Ref. |
| Plantae | Ebenaceae | Diospyros kaki  | Ref. |
| Plantae | Ebenaceae | Diospyros leucomelas | Ref. |
| Plantae | Ebenaceae | Diospyros lotus  | Ref. |
| Plantae | Ebenaceae | Diospyros malanonilau | Ref. |
| Plantae | Ebenaceae | Diospyros melanoxylon  | Ref. |
| Plantae | Ebenaceae | Diospyros montana  | Ref. |
| Plantae | Ebenaceae | Diospyros morrisiana | Ref. |
| Plantae | Ebenaceae | Diospyros quaesita | Ref. |
| Plantae | Ebenaceae | Diospyros tomentosa  | Ref. |
| Plantae | Ericaceae | Arbutus andrachne L.  | Ref. |
| Plantae | Ericaceae | Enkianthus cernuus | Ref. |
| Plantae | Ericaceae | Epigaea asiatica | Ref. |
| Plantae | Ericaceae | Leucothoe grayana Max. | Ref. |
| Plantae | Ericaceae | Pieris japonica D.Don.  | Ref. |
| Plantae | Ericaceae | Pyrola incarnata | Ref. |
| Plantae | Ericaceae | Pyrola japonica  | Ref. |
| Plantae | Ericaceae | Pyrola rugosa | Ref. |
| Plantae | Ericaceae | Rhododendron hymenanthus | Ref. |
| Plantae | Eucommiaceae | Eucommia ulmoides  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia paralias | Ref. |
| Plantae | Fabaceae | Indigofera tetrantha | Ref. |
| Plantae | Gentianaceae | Gentianopsis paludosa | Ref. |
| Plantae | Hydrangeaceae | Hydrangea heteromalla | Ref. |
| Plantae | Icacinaceae | Gonocaryum calleryanum  | Ref. |
| Plantae | Juglandaceae | Platycarya strobilacea | Ref. |
| Plantae | Labiatae | Callicarpa arborea  | Ref. |
| Plantae | Labiatae | Callicarpa formosana  | Ref. |
| Plantae | Labiatae | Callicarpa macrophylla  | Ref. |
| Plantae | Labiatae | Dracocephalum kotschyi  | Ref. |
| Plantae | Labiatae | Glechoma lungituba | Ref. |
| Plantae | Labiatae | Hyptis brevipes  | Ref. |
| Plantae | Labiatae | Isodon oresbia | Ref. |
| Plantae | Labiatae | Isodon ternifolius | Ref. |
| Plantae | Labiatae | Lavandula canariensis | Ref. |
| Plantae | Labiatae | Lavandula gibsonii | Ref. |
| Plantae | Labiatae | Meriandra benghalensis  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Origanum dubium | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Labiatae | Orthosiphon stamineus  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Labiatae | Prostanthera melissifolia | Ref. |
| Plantae | Labiatae | Prunella vulgaris  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Salvia breviflora | Ref. |
| Plantae | Labiatae | Salvia canariensis L. | Ref. |
| Plantae | Labiatae | Salvia chinopeplica | Ref. |
| Plantae | Labiatae | Salvia miltiorrhiza  | Ref. |
| Plantae | Labiatae | Salvia nicolsoniana | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Salvia virgata | Ref. |
| Plantae | Labiatae | Satureja acinos | Ref. |
| Plantae | Labiatae | Satureja calamintha | Ref. |
| Plantae | Labiatae | Sideritis candicans var.eriocephala | Ref. |
| Plantae | Labiatae | Sideritis discolor | Ref. |
| Plantae | Labiatae | Sideritis soluta | Ref. |
| Plantae | Labiatae | Thymus pubescens | Ref. |
| Plantae | Lamiaceae | Coleus aromaticus  | Ref. |
| Plantae | Lamiaceae | Rabdosia rubescens  | Ref. |
| Plantae | Longaniaceae | Strychnos vanprukii Craib. | Ref. |
| Plantae | Lythraceae | Lawsonia inermis  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malpighiaceae | Acridocarpus vivy | Ref. |
| Plantae | Melastomataceae | Monochaetum vulcanicum | Ref. |
| Plantae | Moraceae | Ficus microcarpa  | Ref. |
| Plantae | Moraceae | Morus australis  | Ref. |
| Plantae | Myricaceae | Myrica rubra  | Ref. |
| Plantae | Myrtaceae | Eucalyptus citriodora  | Ref. |
| Plantae | Myrtaceae | Eucalyptus tereticornis  | Ref. |
| Plantae | Myrtaceae | Leptospermum scoparium  | Ref. |
| Plantae | Myrtaceae | Melaleuca ericifolia | Ref. |
| Plantae | Myrtaceae | Melaleuca leucadendron  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Myrtaceae | Syzygium buxifolium | Ref. |
| Plantae | Myrtaceae | Syzygium formosanum | Ref. |
| Plantae | Oleaceae | Forsythia suspensa  | Ref. |
| Plantae | Oleaceae | Ligustrum lucidum  | Ref. |
| Plantae | Oleaceae | Phillyrea latifolia L.  | Ref. |
| Plantae | Onagraceae | Ludwigia octovalvis  | Ref. |
| Plantae | Paulowniaceae | Paulownia tomentosa | Ref. |
| Plantae | Pinaceae | Pinus roxburghii  | Ref. |
| Plantae | Plantaginaceae | Plantago asiatica  | Ref. |
| Plantae | Plantaginaceae | Plantago depressa  | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Polygonaceae | Coccoloba excoriata | Ref. |
| Plantae | Rhamnaceae | Ziziphus jujuba  | Ref. |
| Plantae | Rhamnaceae | Ziziphus jujuba var.spinosa  | Ref. |
| Plantae | Rosaceae | Chaenomeles sinensis  | Ref. |
| Plantae | Rosaceae | Crataegus cuneata  | Ref. |
| Plantae | Rosaceae | Crataegus hupehensis | Ref. |
| Plantae | Rosaceae | Crataegus pinnatifida  | Ref. |
| Plantae | Rosaceae | Crataegus pinnatifida var.major  | Ref. |
| Plantae | Rosaceae | Eriobotrya japonica  | Ref. |
| Plantae | Rosaceae | Photinia serrulata | Ref. |
| Plantae | Rosaceae | Potentilla chinensis  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Prunus serotina  | Ref. |
| Plantae | Rosaceae | Rosa multiflora  | Ref. |
| Plantae | Rosaceae | Rubus ellipticus  | Ref. |
| Plantae | Rubiaceae | Coussarea paniculata | Ref. |
| Plantae | Rubiaceae | Gardenia jasminoides  | Ref. |
| Plantae | Rubiaceae | Hedyotis dichotoma | Ref. |
| Plantae | Rubiaceae | Hedyotis herbacea | Ref. |
| Plantae | Rubiaceae | Lasianthus gardneri | Ref. |
| Plantae | Rubiaceae | Mitragyna speciosa | Ref. |
| Plantae | Rubiaceae | Mitragyna stipulosa  | Ref. |
| Plantae | Rubiaceae | Morinda citrifolia  | Ref. |
| Plantae | Rubiaceae | Morinda officinalis  | Ref. |
| Plantae | Rubiaceae | Morinda tinctoria var.tomentosa.  | Ref. |
| Plantae | Rubiaceae | Oldenlandia diffusa  | Ref. |
| Plantae | Rubiaceae | Ophiorrhiza liukiuensis | Ref. |
| Plantae | Rubiaceae | Rubia wallichiana  | Ref. |
| Plantae | Rubiaceae | Uncaria tomentosa  | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana laxiflora | Ref. |
| Plantae | Verbenaceae | Verbena littoralis  | Ref. |
| Plantae | Verbenaceae | Verbena officinalis  | Ref. |
| - | - | Aganosma caryophyllata | Ref. |
| - | - | Clerodendranthus spicatus | Ref. |
| - | - | Hex aquifolium | Ref. |
|
|
zoom in
| Organism | Gentianopsis paludosa | | Reference | Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Wang, et al., APS, 31, (1996), 764.
Ding, et al., NPRD, 10, (1998), 6.
Zhao, et al., ZYZ, 29, (1994), 523.
Pan, et al., CCMM, 19, (1994), 102.
Lu, et al., CCMM, 22, (1997), 680.
Huang, et al., CCMM, 23, (1998), 37.
Zhou, et al., CCMM, 23, (1998), 164.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Saeidnia, et al., Chem Pharm Bull, 52, (2004), 1249.
Chang, et al., JNP, 67, (2004), 91.
Ito, et al., JNP, 64, (2001), 737.
Lee, et al., Planta Med, 70, (2004), 1119.
MATSUDA, et al., Chem Pharm Bull, 50, (2002), 208.
WU, et al., Chem Pharm Bull, 51, (2003), 948.
Calixto, et al., Planta Med, 69, (2003), 973.
KITAJIMA, et al., Chem Pharm Bull, 53, (2005), 1355.
Ma, et al., JNP, 67, (2004), 1598.
Wu, et al., JNP, 66, (2003), 1207.
Gu, et al., Planta Med, 70, (2004), 509.
Jin, et al., Planta Med, 70, (2004), 564.
Shin, et al., Planta Med, 70, (2004), 803.
Chiang, et al., Phytochemistry, 66, (2005), 495.
Xie, et al., Phytochemistry, 66, (2005), 2340.
Li, et al., Planta Med, 69, (2003), 356.
Lee, et al., Planta Med, 69, (2003), 327.
Heitzman, et al., Phytochemistry, 66, (2005), 5.
Yoshimura, et al., Planta Med, 69, (2003), 673.
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|