| Name |
Succinic acid |
| Formula |
C4H6O4 |
| Mw |
118.02660868 |
| CAS RN |
110-15-6 |
| C_ID |
C00001205
, 
|
| InChIKey |
KDYFGRWQOYBRFD-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C4H6O4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6)(H,7,8) |
| SMILES |
O=C(O)CCC(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Serum) | Ref. |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Angelica sinensis  | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Araceae | Pothos chinensis  | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asphodelaceae | Aloe vera  | Ref. |
| Plantae | Asteraceae | Conyza blinii | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Asteraceae | Onopordum acanthium  | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Lobelia chinense | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
| Plantae | Chloranthaceae | Sarcandra glabra  | Ref. |
| Plantae | Crassulaceae | Rhodiola crenulata | Ref. |
| Plantae | Crassulaceae | Rhodiola rosea  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica oleracea  | Ref. |
| Plantae | Elaeagnaceae | Hippophae rhamnoides  | Ref. |
| Plantae | Equisetaceae | Equisetum hoemale | Ref. |
| Plantae | Fabaceae | Lespedeza cuneata | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Gunneraceae | Gunnera perpensa  | Ref. |
| Plantae | Gunneraceae | Gunnera sp. | Ref. |
| Plantae | Juglandaceae | Juglans mandshurica | Ref. |
| Plantae | Labiatae | Orthosiphon stamineus  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Myrsinaceae | Ardisia arborescens | Ref. |
| Plantae | Orchidaceae | Gastrodia elata  | Ref. |
| Plantae | Orobanchaceae | Cistanche deserticola  | Ref. |
| Plantae | Osmundaceae | Osmunda japonica  | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Polygonaceae | Fagopyrum cymosum  | Ref. |
| Plantae | Rhamnaceae | Sageretia theezans  | Ref. |
| Plantae | Rosaceae | Crataegus pinnatifida  | Ref. |
| Plantae | Rosaceae | Crataegus scabrifolia | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rutaceae | Citrus medica  | Ref. |
| Plantae | Santalaceae | Thesium chinense | Ref. |
| Plantae | Sapotaceae | Sebertia acuminata | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Stemonaceae | Stemona tuberosa  | Ref. |
| Plantae | Typhaceae | Typha angustata  | Ref. |
| Plantae | Typhaceae | Typha latifolia  | Ref. |
| Plantae | Urticaceae | Urtica dioica  | Ref. |
| Plantae | Zingiberaceae | Curcuma domestica  | Ref. |
| Plantae | Zygophyllaceae | Tribulus terrestris  | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | Changium smyrnioides | Ref. |
| - | - | FOOD SAKE | Ref. |
| - | - | Siegesbeckia orientalis var.glabrescens  | Ref. |
|
|
zoom in
| Organism | Typha latifolia | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Li, et al., APS, 33, (1998), 591.
Fu, et al., ZYZ, 33, (1998), 140.
Zhou, et al., CCMM, 19, (1994), 162.
Xu, et al., CCMM, 19, (1994), 675.
Chen, et al., CCMM, 18, (1993), 424.
Shi, et al., CCMM, 22, (1997), 743.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Zheng, et al., JNP, 67, (2004), 1617.
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|