| Name |
(-)-Cytisine Cytisine |
| Formula |
C11H14N2O |
| Mw |
190.11061308 |
| CAS RN |
485-35-8 |
| C_ID |
C00002218
, 
|
| InChIKey |
ANJTVLIZGCUXLD-BRJQIKQINA-N |
| InChICode |
InChI=1S/C11H14N2O/c14-11-3-1-2-10-9-4-8(5-12-6-9)7-13(10)11/h1-3,8-9,12H,4-7H2/t8-,9+/m1/s1 |
| SMILES |
O=c1cccc2n1C[C@@H]1CNC[C@H]2C1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Pro L-Lys L-Arg L-Asp |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Spondias mangifera | Ref. |
| Plantae | Convolvulaceae | Cuscuta platyloba | Ref. |
| Plantae | Fabaceae | Anagyris spp. | Ref. |
| Plantae | Fabaceae | Baptisia australis | Ref. |
| Plantae | Fabaceae | Baptisia spp. | Ref. |
| Plantae | Fabaceae | Baptisia tinctoria R.Br.  | Ref. |
| Plantae | Fabaceae | Bolusanthus specious | Ref. |
| Plantae | Fabaceae | Chamaecytisus eriocarpus | Ref. |
| Plantae | Fabaceae | Cladrastis amurensis | Ref. |
| Plantae | Fabaceae | Clathrotropis glaucophylla | Ref. |
| Plantae | Fabaceae | Cytisus canariensis | Ref. |
| Plantae | Fabaceae | Cytisus laburnum L. | Ref. |
| Plantae | Fabaceae | Cytisus monspessulanus L. | Ref. |
| Plantae | Fabaceae | Cytisus spp. | Ref. |
| Plantae | Fabaceae | Euchresta formosana | Ref. |
| Plantae | Fabaceae | Euchresta horsfieldii  | Ref. |
| Plantae | Fabaceae | Genista germanica | Ref. |
| Plantae | Fabaceae | Genista libanotica | Ref. |
| Plantae | Fabaceae | Genista spp. | Ref. |
| Plantae | Fabaceae | Genista tinctoria  | Ref. |
| Plantae | Fabaceae | Laburnum alpinum x wateri | Ref. |
| Plantae | Fabaceae | Laburnum anagyroides  | Ref. |
| Plantae | Fabaceae | Maackia tashiroi | Ref. |
| Plantae | Fabaceae | Petteria ramentacea | Ref. |
| Plantae | Fabaceae | Piptanthus concolor | Ref. |
| Plantae | Fabaceae | Piptanthus nepalensis | Ref. |
| Plantae | Fabaceae | Sophora alopecuroides L. | Ref. |
| Plantae | Fabaceae | Sophora chrysophylla | Ref. |
| Plantae | Fabaceae | Sophora griffithii Stocks. | Ref. |
| Plantae | Fabaceae | Sophora japonica L.  | Ref. |
| Plantae | Fabaceae | Sophora macrophylla | Ref. |
| Plantae | Fabaceae | Sophora pachycarpa Schrenk. | Ref. |
| Plantae | Fabaceae | Sophora secundiflora  | Ref. |
| Plantae | Fabaceae | Sophora speciosa | Ref. |
| Plantae | Fabaceae | Sophora spp. | Ref. |
| Plantae | Fabaceae | Sophora tomentosa  | Ref. |
| Plantae | Fabaceae | Sophora tonkinensis | Ref. |
| Plantae | Fabaceae | Sophora viciifolia | Ref. |
| Plantae | Fabaceae | Spartium junceum  | Ref. |
| Plantae | Fabaceae | Templetonia retusa | Ref. |
| Plantae | Fabaceae | Thermopsis alterniflora Rgl.et Schmalh. | Ref. |
| Plantae | Fabaceae | Thermopsis lanceolata R.Br. | Ref. |
| Plantae | Fabaceae | Thermopsis rhombifolia | Ref. |
| Plantae | Fabaceae | Thermopsis spp. | Ref. |
| Plantae | Fabaceae | Ulex airensis | Ref. |
| Plantae | Fabaceae | Ulex australis | Ref. |
| Plantae | Fabaceae | Ulex densus | Ref. |
| Plantae | Fabaceae | Ulex europaeus  | Ref. |
| Plantae | Fabaceae | Ulex jussiaei | Ref. |
| Plantae | Fabaceae | Ulex minor | Ref. |
| Plantae | Fabaceae | Vexibia pachycarpa | Ref. |
| Plantae | Fumariaceae | Corydalis yanhusuo  | Ref. |
| Plantae | Santalaceae | Viscum cruciatum  | Ref. |
|
|
zoom in
| Organism | Corydalis yanhusuo | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|