| Name |
Protopine Biflorine Corydinine Fumarin Fumarine |
| Formula |
C20H19NO5 |
| Mw |
353.12632273 |
| CAS RN |
130-86-9 |
| C_ID |
C00001906
, 
|
| InChIKey |
GPTFURBXHJWNHR-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H19NO5/c1-21-5-4-13-7-18-19(25-10-24-18)8-14(13)16(22)6-12-2-3-17-20(15(12)9-21)26-11-23-17/h2-3,7-8H,4-6,9-11H2,1H3 |
| SMILES |
CN1CCc2cc3c(cc2C(=O)Cc2ccc4c(c2C1)OCO4)OCO3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Annona squamosa  | Ref. |
| Plantae | Berberidaceae | Nandina domestica  | Ref. |
| Plantae | Fumariaceae | Corydalis adunca | Ref. |
| Plantae | Fumariaceae | Corydalis ambigua var.amurensis  | Ref. |
| Plantae | Fumariaceae | Corydalis bungeana  | Ref. |
| Plantae | Fumariaceae | Corydalis caucasia | Ref. |
| Plantae | Fumariaceae | Corydalis cava  | Ref. |
| Plantae | Fumariaceae | Corydalis claviculata | Ref. |
| Plantae | Fumariaceae | Corydalis decumbens  | Ref. |
| Plantae | Fumariaceae | Corydalis esquirolii | Ref. |
| Plantae | Fumariaceae | Corydalis gigantea Trautv.et Mey. | Ref. |
| Plantae | Fumariaceae | Corydalis glaucescens | Ref. |
| Plantae | Fumariaceae | Corydalis gortschakovii | Ref. |
| Plantae | Fumariaceae | Corydalis hsuchowensis | Ref. |
| Plantae | Fumariaceae | Corydalis intermedia | Ref. |
| Plantae | Fumariaceae | Corydalis ledebouriana K.et K. | Ref. |
| Plantae | Fumariaceae | Corydalis longicalcarata | Ref. |
| Plantae | Fumariaceae | Corydalis majori | Ref. |
| Plantae | Fumariaceae | Corydalis nobilis | Ref. |
| Plantae | Fumariaceae | Corydalis omeiensis | Ref. |
| Plantae | Fumariaceae | Corydalis pallida | Ref. |
| Plantae | Fumariaceae | Corydalis pseudoadunca | Ref. |
| Plantae | Fumariaceae | Corydalis racemosa | Ref. |
| Plantae | Fumariaceae | Corydalis remota | Ref. |
| Plantae | Fumariaceae | Corydalis repens | Ref. |
| Plantae | Fumariaceae | Corydalis sewerzovii | Ref. |
| Plantae | Fumariaceae | Corydalis solida  | Ref. |
| Plantae | Fumariaceae | Corydalis stricta Steph. | Ref. |
| Plantae | Fumariaceae | Corydalis suaveolens | Ref. |
| Plantae | Fumariaceae | Corydalis tashiro | Ref. |
| Plantae | Fumariaceae | Corydalis thyrsifolia | Ref. |
| Plantae | Fumariaceae | Corydalis turtschaninowii | Ref. |
| Plantae | Fumariaceae | Corydalis yanhusuo  | Ref. |
| Plantae | Fumariaceae | Dicentra spectabilis | Ref. |
| Plantae | Fumariaceae | Fumaria agraria | Ref. |
| Plantae | Fumariaceae | Fumaria asepala  | Ref. |
| Plantae | Fumariaceae | Fumaria bastardii | Ref. |
| Plantae | Fumariaceae | Fumaria bella | Ref. |
| Plantae | Fumariaceae | Fumaria capreolata  | Ref. |
| Plantae | Fumariaceae | Fumaria cilicica | Ref. |
| Plantae | Fumariaceae | Fumaria densiflora | Ref. |
| Plantae | Fumariaceae | Fumaria gaillardotii | Ref. |
| Plantae | Fumariaceae | Fumaria indica  | Ref. |
| Plantae | Fumariaceae | Fumaria judaica | Ref. |
| Plantae | Fumariaceae | Fumaria kralikii | Ref. |
| Plantae | Fumariaceae | Fumaria macrocarpa | Ref. |
| Plantae | Fumariaceae | Fumaria muralis | Ref. |
| Plantae | Fumariaceae | Fumaria officinalis  | Ref. |
| Plantae | Fumariaceae | Fumaria parviflora | Ref. |
| Plantae | Fumariaceae | Fumaria petteri | Ref. |
| Plantae | Fumariaceae | Fumaria schleicheri | Ref. |
| Plantae | Fumariaceae | Fumaria schramii | Ref. |
| Plantae | Fumariaceae | Fumaria sepium | Ref. |
| Plantae | Fumariaceae | Fumaria spicata | Ref. |
| Plantae | Fumariaceae | Fumaria vaillantii  | Ref. |
| Plantae | Fumariaceae | Hypecoum erectum L. | Ref. |
| Plantae | Fumariaceae | Hypecoum leptocarpum  | Ref. |
| Plantae | Fumariaceae | Hypecoum pendulum L. | Ref. |
| Plantae | Fumariaceae | Hypecoum procumbens | Ref. |
| Plantae | Fumariaceae | Hypecoum trilobum | Ref. |
| Plantae | Fumariaceae | Platycapnos saxicola | Ref. |
| Plantae | Fumariaceae | Platycapnos spicata | Ref. |
| Plantae | Fumariaceae | Sarcocapnos baetica | Ref. |
| Plantae | Fumariaceae | Sarcocapnos enneaphylla | Ref. |
| Plantae | Fumariaceae | Sarcocapnos saetabensis | Ref. |
| Plantae | Papaveraceae | Arctomecon californica | Ref. |
| Plantae | Papaveraceae | Arctomecon humilis | Ref. |
| Plantae | Papaveraceae | Arctomecon merrianii | Ref. |
| Plantae | Papaveraceae | Argemone mexicana  | Ref. |
| Plantae | Papaveraceae | Argemone subfusiformia | Ref. |
| Plantae | Papaveraceae | Argemone subfusiformis var.subinermis  | Ref. |
| Plantae | Papaveraceae | Chelidonium majus L.  | Ref. |
| Plantae | Papaveraceae | Eomecon chionantha | Ref. |
| Plantae | Papaveraceae | Eschscholzia californica  | Ref. |
| Plantae | Papaveraceae | Glaucium arabicum | Ref. |
| Plantae | Papaveraceae | Glaucium corniculatum  | Ref. |
| Plantae | Papaveraceae | Glaucium fimbrilligerum | Ref. |
| Plantae | Papaveraceae | Glaucium flavum  | Ref. |
| Plantae | Papaveraceae | Glaucium grandiflorum | Ref. |
| Plantae | Papaveraceae | Hunnemannia fumariaefolia Sweet. | Ref. |
| Plantae | Papaveraceae | Macleaya cordata  | Ref. |
| Plantae | Papaveraceae | Meconopsis cambrica | Ref. |
| Plantae | Papaveraceae | Meconopsis robusta | Ref. |
| Plantae | Papaveraceae | Papaver albiforum | Ref. |
| Plantae | Papaveraceae | Papaver argemone | Ref. |
| Plantae | Papaveraceae | Papaver bracteatum  | Ref. |
| Plantae | Papaveraceae | Papaver californicum | Ref. |
| Plantae | Papaveraceae | Papaver confine | Ref. |
| Plantae | Papaveraceae | Papaver curviscapum | Ref. |
| Plantae | Papaveraceae | Papaver dubium | Ref. |
| Plantae | Papaveraceae | Papaver fugax | Ref. |
| Plantae | Papaveraceae | Papaver kerneri | Ref. |
| Plantae | Papaveraceae | Papaver macrostomum | Ref. |
| Plantae | Papaveraceae | Papaver orientale L.  | Ref. |
| Plantae | Papaveraceae | Papaver persicum Lindl. | Ref. |
| Plantae | Papaveraceae | Papaver pinnatifidum | Ref. |
| Plantae | Papaveraceae | Papaver radicatum | Ref. |
| Plantae | Papaveraceae | Papaver rhoeas chelidonides  | Ref. |
| Plantae | Papaveraceae | Papaver rhopalothece | Ref. |
| Plantae | Papaveraceae | Papaver somniferum  | Ref. |
| Plantae | Papaveraceae | Papaver stevenianum | Ref. |
| Plantae | Papaveraceae | Papaver tatricum | Ref. |
| Plantae | Ranunculaceae | Thalictrum atriplex | Ref. |
| Plantae | Ranunculaceae | Thalictrum faberi | Ref. |
| Plantae | Ranunculaceae | Thalictrum flavum | Ref. |
| Plantae | Ranunculaceae | Thalictrum foliolosum  | Ref. |
| Plantae | Ranunculaceae | Thalictrum gladulosissimum | Ref. |
| Plantae | Ranunculaceae | Thalictrum glandulosissimum | Ref. |
| Plantae | Ranunculaceae | Thalictrum isopyroides | Ref. |
| Plantae | Ranunculaceae | Thalictrum microgyum | Ref. |
| Plantae | Ranunculaceae | Thalictrum petaloideum | Ref. |
| Plantae | Ranunculaceae | Thalictrum simplex | Ref. |
| Plantae | Ranunculaceae | Thalictrum thunbergii | Ref. |
| Plantae | Ranunculaceae | Thalictrum triternatum | Ref. |
| Plantae | Rhamnaceae | Ziziphus jujuba  | Ref. |
| Plantae | Rubiaceae | Gallium aparine | Ref. |
| Plantae | Rubiaceae | Oldenlandia biflora | Ref. |
| - | - | Chelidonum majus | Ref. |
| - | - | Dactylocapnos torulosa | Ref. |
|
|
zoom in
| Organism | Fumaria schramii | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|