| Name |
Xanthotoxin 8-Methoxypsoralen |
| Formula |
C12H8O4 |
| Mw |
216.04225874 |
| CAS RN |
298-81-7 |
| C_ID |
C00000576
, 
|
| InChIKey |
QXKHYNVANLEOEG-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C12H8O4/c1-14-12-10-8(4-5-15-10)6-7-2-3-9(13)16-11(7)12/h2-6H,1H3 |
| SMILES |
COc1c2occc2cc2ccc(=O)oc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Ammi majus  | Ref. |
| Plantae | Apiaceae | Angelica archangelica  | Ref. |
| Plantae | Apiaceae | Angelica gigas  | Ref. |
| Plantae | Apiaceae | Angelica keiskei  | Ref. |
| Plantae | Apiaceae | Angelica officinalis | Ref. |
| Plantae | Apiaceae | Angelica pubescens f.biserrata  | Ref. |
| Plantae | Apiaceae | Angelica taiwaniana | Ref. |
| Plantae | Apiaceae | Angelica ursina Maxim | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Cnidium monnieri  | Ref. |
| Plantae | Apiaceae | Ferula sumbul  | Ref. |
| Plantae | Apiaceae | Heracleum asperum | Ref. |
| Plantae | Apiaceae | Heracleum canescens | Ref. |
| Plantae | Apiaceae | Heracleum granatense | Ref. |
| Plantae | Apiaceae | Heracleum grandiflorum | Ref. |
| Plantae | Apiaceae | Heracleum lanatum  | Ref. |
| Plantae | Apiaceae | Heracleum mantegazzianum | Ref. |
| Plantae | Apiaceae | Heracleum moellendorffii Hance | Ref. |
| Plantae | Apiaceae | Heracleum moellendorffii Hance var.paucivitatum | Ref. |
| Plantae | Apiaceae | Heracleum pinnatum | Ref. |
| Plantae | Apiaceae | Heracleum ponticum | Ref. |
| Plantae | Apiaceae | Heracleum sphondylium  | Ref. |
| Plantae | Apiaceae | Heracleum woroschiklowii | Ref. |
| Plantae | Apiaceae | Ligusticum multivittatum | Ref. |
| Plantae | Apiaceae | Niphogeton ternata | Ref. |
| Plantae | Apiaceae | Pastinaca sativa  | Ref. |
| Plantae | Apiaceae | Petroselinum crispum  | Ref. |
| Plantae | Apiaceae | Peucedanum praeruptorum | Ref. |
| Plantae | Apiaceae | Pleurospermum rivulorum | Ref. |
| Plantae | Apiaceae | Prangos tschimganica  | Ref. |
| Plantae | Apiaceae | Saposhnikovia divaricata Schischkin | Ref. |
| Plantae | Apiaceae | Seseli tortuosum LBS.Eur. | Ref. |
| Plantae | Apiaceae | Seseli webbii Cosson. | Ref. |
| Plantae | Apiaceae | Tordylium apulum  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Fabaceae | Bituminaria bituminosa | Ref. |
| Plantae | Fabaceae | Caragana frutex | Ref. |
| Plantae | Fabaceae | Psoralea corylifolia  | Ref. |
| Plantae | Fabaceae | Vicia sativa  | Ref. |
| Plantae | Rutaceae | Aegle marmelos  | Ref. |
| Plantae | Rutaceae | Atalantia ceylanica | Ref. |
| Plantae | Rutaceae | Clausena anisata  | Ref. |
| Plantae | Rutaceae | Dictamnus hispanicus  | Ref. |
| Plantae | Rutaceae | Fagara mayu | Ref. |
| Plantae | Rutaceae | Fagara spp. | Ref. |
| Plantae | Rutaceae | Feronia limonia  | Ref. |
| Plantae | Rutaceae | Leptothyrsa sprucei | Ref. |
| Plantae | Rutaceae | Ruta graveolens  | Ref. |
| Plantae | Rutaceae | Ruta spp. | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| - | - | Oppopanax chironium | Ref. |
| - | - | Pasinaca sativa | Ref. |
|
|
zoom in
| Organism | Pasinaca sativa | | Reference | Ji, et al., Pharmacological Action and Application of Available Antitumor Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1998).
Cui, et al., CCMM, 20, (1995), 743.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Kang, et al., JNP, 64, (2001), 683.
DUAN, et al., Chem Pharm Bull, 50, (2002), 115.
Marquez, et al., Planta Med, 70, (2004), 1016.
Yang, et al., Planta Med, 69, (2003), 1091.
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|