| Name |
Aloesaponarin II |
| Formula |
C15H10O4 |
| Mw |
254.05790881 |
| CAS RN |
53254-94-7 |
| C_ID |
C00064388
|
| InChIKey |
BXWJOXJOMFDQNV-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O4/c1-7-5-8(16)6-10-12(7)15(19)13-9(14(10)18)3-2-4-11(13)17/h2-6,16-17H,1H3 |
| SMILES |
Cc1cc(O)cc2c1C(=O)c1c(O)cccc1C2=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Aloe barbadensis  | Ref. |
| Plantae | Asphodelaceae | Aloe graminicola | Ref. |
| Plantae | Asphodelaceae | Aloe megalacantha | Ref. |
| Plantae | Asphodelaceae | Aloe sabaea | Ref. |
| Plantae | Asphodelaceae | Aloe saponaria  | Ref. |
| Plantae | Asphodelaceae | Aloe turkanensis | Ref. |
| Plantae | Asphodelaceae | Aloe vera  | Ref. |
|
|
zoom in
| Organism | Aloe turkanensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|