| Name |
7-O-Methylaloesin (-)-7-O-Methylaloesin |
| Formula |
C20H24O9 |
| Mw |
408.14203237 |
| CAS RN |
105317-68-8 |
| C_ID |
C00036661
, 
|
| InChIKey |
CNMGVPHFWMWCGL-OPQWJMHZNA-N |
| InChICode |
InChI=1S/C20H24O9/c1-8-4-12(27-3)15(20-18(26)17(25)16(24)13(7-21)29-20)19-14(8)11(23)6-10(28-19)5-9(2)22/h4,6,13,16-18,20-21,24-26H,5,7H2,1-3H3/t13-,16-,17+,18-,20+/m1/s1 |
| SMILES |
COc1cc(C)c2c(=O)cc(CC(C)=O)oc2c1[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Aloe barbadensis  | Ref. |
| Plantae | Asphodelaceae | Aloe ferox  | Ref. |
| Plantae | Asphodelaceae | Aloe harlans | Ref. |
| Plantae | Asphodelaceae | Aloe hildebrandtii | Ref. |
| Plantae | Asphodelaceae | Aloe marlothii  | Ref. |
| Plantae | Asphodelaceae | Aloe rupestris | Ref. |
|
|
zoom in
| Organism | Aloe rupestris | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|