| Name |
Ammajin Marmesinin (-)-Marmesinin |
| Formula |
C20H24O9 |
| Mw |
408.14203237 |
| CAS RN |
495-30-7 |
| C_ID |
C00029680
, 
|
| InChIKey |
HXCGUCZXPFBNRD-HQVZANRQNA-N |
| InChICode |
InChI=1S/C20H24O9/c1-20(2,29-19-18(25)17(24)16(23)13(8-21)28-19)14-6-10-5-9-3-4-15(22)27-11(9)7-12(10)26-14/h3-5,7,13-14,16-19,21,23-25H,6,8H2,1-2H3/t13-,14+,16-,17+,18-,19+/m1/s1 |
| SMILES |
CC(C)(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C1Cc2cc3ccc(=O)oc3cc2O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Angelica furcijuga KITAGAWA | Ref. |
| Plantae | Apiaceae | Angelica pubescens  | Ref. |
| Plantae | Apiaceae | Glehnia littoralis  | Ref. |
| Plantae | Apiaceae | Heracleum candicans WALL.  | Ref. |
| Plantae | Apiaceae | Ostericum koreanum | Ref. |
| Plantae | Rutaceae | Aegle marmelos  | Ref. |
| Plantae | Rutaceae | Ruta graveolens  | Ref. |
|
|
zoom in
| Organism | Aegle marmelos | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|