| Name |
Seychellene |
| Formula |
C15H24 |
| Mw |
204.18780077 |
| CAS RN |
20085-93-2 |
| C_ID |
C00021999
, 
|
| InChIKey |
QQWUXXGYAQMTAT-BTISACJANA-N |
| InChICode |
InChI=1S/C15H24/c1-10-5-7-14(3)11(2)12-6-8-15(14,4)13(10)9-12/h10,12-13H,2,5-9H2,1,3-4H3/t10-,12+,13-,14-,15-/m0/s1 |
| SMILES |
C=C1C2CC[C@@]3(C)[C@@H](C2)[C@@H](C)CCC13C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Pogostemon cablin  | Ref. |
| Plantae | Labiatae | Pogostemon patchouli Pellet.  | Ref. |
| Plantae | Myrtaceae | Myrtus communis  | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
| Plantae | Valerianaceae | Nardostachys chinensis  | Ref. |
| Plantae | Valerianaceae | Nardostachys jatamansi  | Ref. |
| Plantae | Zingiberaceae | Curcuma phaeocaulis  | Ref. |
|
|
zoom in
| Organism | Nardostachys jatamansi | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|