| Name |
Chaetoglobosin C |
| Formula |
C32H36N2O5 |
| Mw |
528.26242227 |
| CAS RN |
50645-76-6 |
| C_ID |
C00011309
, 
|
| InChIKey |
RIZAHVBYKWUPHQ-FPDBGCOONA-N |
| InChICode |
InChI=1S/C32H36N2O5/c1-17-8-7-10-22-29-31(4,39-29)19(3)27-24(15-20-16-33-23-11-6-5-9-21(20)23)34-30(38)32(22,27)26(36)13-12-25(35)28(37)18(2)14-17/h5-7,9-11,14,16-17,19,22,24,27,29,33H,8,12-13,15H2,1-4H3,(H,34,38)/b10-7+,18-14+/t17-,19-,22-,24-,27-,29-,31+,32-/m0/s1 |
| SMILES |
C/C1=C[C@@H](C)C/C=C/[C@H]2[C@@H]3O[C@]3(C)[C@@H](C)[C@H]3[C@H](Cc4c[nH]c5ccccc45)NC(=O)[C@]32C(=O)CCC(=O)C1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
L-Trp IPP |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Chaetomiaceae | Chaetomium cochlioides | Ref. |
| Fungi | Chaetomiaceae | Chaetomium globosum | Ref. |
| Fungi | Chaetomiaceae | Chaetomium mollipilium | Ref. |
| Fungi | Chaetomiaceae | Chaetomium rectum | Ref. |
| Fungi | Chaetomiaceae | Chaetomium subaffine | Ref. |
| Fungi | Trichocomaceae | Penicillium aurantiovirens | Ref. |
|
|
zoom in
| Organism | Penicillium aurantiovirens | | Reference | Cole,Handbook of Secondary Fungal Metabolites,Volume I,(2003)
Cole,Handbook of Toxic Fungal Metabolites,(1981),313
Nator,Mycotoxins and Phytoalexins,(1991),291 |
|---|
|