| Name |
Kaempferol 3-rutinoside Nicotiflorin Nicotifloroside Kaempferol 3-O-rutinoside Kaempferol 3-O-(alpha-L-rhamnopyranosyl(1->6)-beta-D-glucopyranoside (-)-Kaempferol 3-O-(alpha-L-rhamnopyranosyl(1->6)-beta-D-glucopyranoside |
| Formula |
C27H30O15 |
| Mw |
594.15847029 |
| CAS RN |
17650-84-9 |
| C_ID |
C00005169
, 
|
| InChIKey |
RTATXGUCZHCSNG-FBSNBPALNA-N |
| InChICode |
InChI=1S/C27H30O15/c1-9-17(31)20(34)22(36)26(39-9)38-8-15-18(32)21(35)23(37)27(41-15)42-25-19(33)16-13(30)6-12(29)7-14(16)40-24(25)10-2-4-11(28)5-3-10/h2-7,9,15,17-18,20-23,26-32,34-37H,8H2,1H3/t9-,15-,17-,18+,20-,21-,22+,23+,26+,27-/m0/s1 |
| SMILES |
CC1O[C@@H](OCC2O[C@@H](Oc3c(-c4ccc(O)cc4)oc4cc(O)cc(O)c4c3=O)C(O)C(O)[C@@H]2O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Agavaceae | Agave americana var.marginata  | Ref. |
| Plantae | Annonaceae | Annona muricata  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apiaceae | Tordylium apulum  | Ref. |
| Plantae | Aristolochiaceae | Aristolochia kaempferi | Ref. |
| Plantae | Asteraceae | Carthamus tinctorius  | Ref. |
| Plantae | Asteraceae | Centaurea hierapolitana | Ref. |
| Plantae | Asteraceae | Clibadium spp. | Ref. |
| Plantae | Asteraceae | Conyza filaginoides | Ref. |
| Plantae | Asteraceae | Desmanthodium spp. | Ref. |
| Plantae | Asteraceae | Montanoa tomentosa | Ref. |
| Plantae | Asteraceae | Scorzonera divaricata | Ref. |
| Plantae | Asteraceae | Silphium perfoliatum L. | Ref. |
| Plantae | Asteraceae | Solidago altissima | Ref. |
| Plantae | Boraginaceae | Alkanna orientalis | Ref. |
| Plantae | Bromeliaceae | Pitcairnia spp. | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Capparaceae | Capparis spinosa L.  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Caryophyllaceae | Dianthus caryophyllus  | Ref. |
| Plantae | Cistaceae | Cistus ladaniferus  | Ref. |
| Plantae | Convolvulaceae | Calystegia japonica  | Ref. |
| Plantae | Crassulaceae | Rhodiola rosea  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Capsella bursa-pastoris  | Ref. |
| Plantae | Cupressaceae | Juniperus communis var.depressa  | Ref. |
| Plantae | Dennstaedtiaceae | Paesia anfractuosa | Ref. |
| Plantae | Dioscoreaceae | Dioscorea alata  | Ref. |
| Plantae | Ebenaceae | Diospyros rhombifolia | Ref. |
| Plantae | Equisetaceae | Equisetum silvaticum | Ref. |
| Plantae | Eucommiaceae | Eucommia ulmoides Oliv.  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia geniculata | Ref. |
| Plantae | Euphorbiaceae | Euphorbia larica | Ref. |
| Plantae | Euphorbiaceae | Euphorbia magalanta | Ref. |
| Plantae | Euphorbiaceae | Euphorbia virgata | Ref. |
| Plantae | Euphorbiaceae | Ricinus communis  | Ref. |
| Plantae | Fabaceae | Bauhinia candicans | Ref. |
| Plantae | Fabaceae | Cassia hirsuta  | Ref. |
| Plantae | Fabaceae | Cassia spp. | Ref. |
| Plantae | Fabaceae | Clitoria ternata | Ref. |
| Plantae | Fabaceae | Clitoria ternatea  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Styphnolobium japonicum | Ref. |
| Plantae | Fumariaceae | Fumaria parviflora  | Ref. |
| Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Labiatae | Marrubium velutinum | Ref. |
| Plantae | Limnanthaceae | Limnanthes douglasii | Ref. |
| Plantae | Longaniaceae | Strychnos spinosa  | Ref. |
| Plantae | Malvaceae | Kleinhovia hospita  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrine | Ref. |
| Plantae | Moringaceae | Moringa stenopetala  | Ref. |
| Plantae | Nymphaeaceae | Nymphaea candida  | Ref. |
| Plantae | Oleaceae | Fraxinus oxycarba | Ref. |
| Plantae | Oleaceae | Nyctanthes arbortristis  | Ref. |
| Plantae | Oleaceae | Nyctanthes arbor-tristis Linn.  | Ref. |
| Plantae | Pinaceae | Abies amabilis | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Poaceae | Cymbopogon citratus  | Ref. |
| Plantae | Pteridaceae | Adiantum capillus-veneris  | Ref. |
| Plantae | Rhamnaceae | Colubrina asiatica  | Ref. |
| Plantae | Rhizophoraceae | Bruguiera sexangula var.rhynchopetala | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rubiaceae | Hedyotis herbacea | Ref. |
| Plantae | Rubiaceae | Morinda citrifolia  | Ref. |
| Plantae | Rubiaceae | Morinda morindoides | Ref. |
| Plantae | Rubiaceae | Sinoadina Racemosa | Ref. |
| Plantae | Rubiaceae | Spermacoce laevis Roxb. | Ref. |
| Plantae | Ruscaceae | Ruscus hypoglossum L.  | Ref. |
| Plantae | Saxifragaceae | Leptarrhena pyrolifolia | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Leucophysalis spp. | Ref. |
| Plantae | Solanaceae | Nicotiana spp. | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Physalis peruviana  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Thymelaeaceae | Edgeworthia chrysantha | Ref. |
| Plantae | Urticaceae | Boehmeria holosericea | Ref. |
| Plantae | Urticaceae | Boehmeria tricuspis | Ref. |
| Plantae | Urticaceae | Urtica dioica  | Ref. |
| Plantae | Zygophyllaceae | Tribulus terrestris  | Ref. |
| Plantae | Zygophyllaceae | Tribulus terrstris | Ref. |
|
|
zoom in
| Organism | Carthamus tinctorius | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Hukuti,J.Pharm.Soc.Japan,59,(1939),258
Vernes,Phytochem.,15,(1976),1320 |
|---|
|